5-Hydroxy-2-(4-hydroxyphenyl)-6-[(2-hydroxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one
| Internal ID | e8120e67-f2b2-43b0-8dfe-fe34e31a9845 |
| Taxonomy | Phenylpropanoids and polyketides > Diarylheptanoids > Linear diarylheptanoids |
| IUPAC Name | 5-hydroxy-2-(4-hydroxyphenyl)-6-[(2-hydroxyphenyl)methyl]-7-methoxy-2,3-dihydrochromen-4-one |
| SMILES (Canonical) | COC1=C(C(=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)O)CC4=CC=CC=C4O |
| SMILES (Isomeric) | COC1=C(C(=C2C(=O)CC(OC2=C1)C3=CC=C(C=C3)O)O)CC4=CC=CC=C4O |
| InChI | InChI=1S/C23H20O6/c1-28-20-12-21-22(23(27)16(20)10-14-4-2-3-5-17(14)25)18(26)11-19(29-21)13-6-8-15(24)9-7-13/h2-9,12,19,24-25,27H,10-11H2,1H3 |
| InChI Key | SCYWNQTZQMNLGR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C23H20O6 |
| Molecular Weight | 392.40 g/mol |
| Exact Mass | 392.12598835 g/mol |
| Topological Polar Surface Area (TPSA) | 96.20 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.60% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.97% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.49% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.22% | 98.95% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.86% | 93.99% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 93.20% | 97.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 91.86% | 94.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.49% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 89.04% | 89.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.43% | 99.23% |
| CHEMBL2535 | P11166 | Glucose transporter | 86.52% | 98.75% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.99% | 99.17% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.80% | 92.62% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.30% | 85.14% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.84% | 99.15% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 83.77% | 96.95% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.47% | 95.89% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.43% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75990290 |
| LOTUS | LTS0064638 |
| wikiData | Q104197179 |