5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one
Internal ID | d026ef02-6ec7-43fc-bd3e-ba55111d4e18 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Flavans > 8-prenylated flavans > 8-prenylated flavanones |
IUPAC Name | 5-hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one |
SMILES (Canonical) | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC(=C(C=C3)OC)O)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C=C(C2=C1OC(CC2=O)C3=CC(=C(C=C3)OC)O)O)OC)C |
InChI | InChI=1S/C22H24O6/c1-12(2)5-7-14-20(27-4)11-17(25)21-16(24)10-19(28-22(14)21)13-6-8-18(26-3)15(23)9-13/h5-6,8-9,11,19,23,25H,7,10H2,1-4H3 |
InChI Key | JXAZZATUCPCXKO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C22H24O6 |
Molecular Weight | 384.40 g/mol |
Exact Mass | 384.15728848 g/mol |
Topological Polar Surface Area (TPSA) | 85.20 Ų |
XlogP | 4.60 |
There are no found synonyms. |
![2D Structure of 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one 2D Structure of 5-Hydroxy-2-(3-hydroxy-4-methoxyphenyl)-7-methoxy-8-(3-methylbut-2-enyl)-2,3-dihydrochromen-4-one](https://plantaedb.com/storage/docs/compounds/2023/11/5-hydroxy-2-3-hydroxy-4-methoxyphenyl-7-methoxy-8-3-methylbut-2-enyl-23-dihydrochromen-4-one.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.10% | 96.09% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 96.05% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 92.49% | 98.95% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.21% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.85% | 86.33% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 90.31% | 85.14% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.37% | 91.49% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.77% | 97.09% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.81% | 95.89% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.61% | 94.00% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 87.37% | 96.12% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.72% | 94.73% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.68% | 99.17% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.64% | 89.00% |
CHEMBL4208 | P20618 | Proteasome component C5 | 83.58% | 90.00% |
CHEMBL2535 | P11166 | Glucose transporter | 82.27% | 98.75% |
CHEMBL3194 | P02766 | Transthyretin | 80.33% | 90.71% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 80.23% | 92.62% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.20% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Glycosmis craibii |
PubChem | 162957738 |
LOTUS | LTS0083618 |
wikiData | Q105136493 |