5-Henicosyldihydrofuran-2(3H)-one
Internal ID | 2a1c741d-fdd2-486f-94fb-e27dac9fe685 |
Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
IUPAC Name | 5-henicosyloxolan-2-one |
SMILES (Canonical) | CCCCCCCCCCCCCCCCCCCCCC1CCC(=O)O1 |
SMILES (Isomeric) | CCCCCCCCCCCCCCCCCCCCCC1CCC(=O)O1 |
InChI | InChI=1S/C25H48O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-24-22-23-25(26)27-24/h24H,2-23H2,1H3 |
InChI Key | FLVQHDPEFVLJND-UHFFFAOYSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C25H48O2 |
Molecular Weight | 380.60 g/mol |
Exact Mass | 380.365430770 g/mol |
Topological Polar Surface Area (TPSA) | 26.30 Ų |
XlogP | 10.80 |
FLVQHDPEFVLJND-UHFFFAOYSA-N |
5-Henicosyldihydrofuran-2(3H)-one |
2(3H)-Furanone, 5-heneicosyldihydro- |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 94.02% | 98.95% |
CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 91.53% | 90.24% |
CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.16% | 89.63% |
CHEMBL2996 | Q05655 | Protein kinase C delta | 89.55% | 97.79% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.88% | 97.25% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.33% | 97.09% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 85.72% | 91.11% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.47% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.27% | 99.17% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 85.15% | 100.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 82.54% | 92.50% |
CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 82.52% | 91.81% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.03% | 96.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.82% | 99.23% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 80.07% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Flourensia cernua |
PubChem | 85292662 |
LOTUS | LTS0131659 |
wikiData | Q103813482 |