5-Ethyl-2-(10-hydroxyundecyl)-6-methoxy-3-methylpyran-4-one
Internal ID | 07577391-8e4c-4bd8-bf90-05a107797c1d |
Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
IUPAC Name | 5-ethyl-2-(10-hydroxyundecyl)-6-methoxy-3-methylpyran-4-one |
SMILES (Canonical) | CCC1=C(OC(=C(C1=O)C)CCCCCCCCCC(C)O)OC |
SMILES (Isomeric) | CCC1=C(OC(=C(C1=O)C)CCCCCCCCCC(C)O)OC |
InChI | InChI=1S/C20H34O4/c1-5-17-19(22)16(3)18(24-20(17)23-4)14-12-10-8-6-7-9-11-13-15(2)21/h15,21H,5-14H2,1-4H3 |
InChI Key | SGIFMADMFIWPSQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H34O4 |
Molecular Weight | 338.50 g/mol |
Exact Mass | 338.24570956 g/mol |
Topological Polar Surface Area (TPSA) | 55.80 Ų |
XlogP | 5.30 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL2581 | P07339 | Cathepsin D | 96.36% | 98.95% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.05% | 91.11% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.90% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 86.10% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 85.91% | 96.09% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.49% | 95.56% |
CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 84.38% | 97.29% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.00% | 99.17% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 83.31% | 90.71% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 81.38% | 96.00% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.19% | 96.95% |
CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 81.13% | 100.00% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.56% | 93.56% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.23% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Podolepis hieracioides |
PubChem | 163088128 |
LOTUS | LTS0117662 |
wikiData | Q105252339 |