5-Ethenyl-4,6-dimethoxy-1-benzofuran
Internal ID | 9608cd11-93c3-480f-b2a6-dc9b9552ac51 |
Taxonomy | Organoheterocyclic compounds > Benzofurans |
IUPAC Name | 5-ethenyl-4,6-dimethoxy-1-benzofuran |
SMILES (Canonical) | COC1=C(C(=C2C=COC2=C1)OC)C=C |
SMILES (Isomeric) | COC1=C(C(=C2C=COC2=C1)OC)C=C |
InChI | InChI=1S/C12H12O3/c1-4-8-10(13-2)7-11-9(5-6-15-11)12(8)14-3/h4-7H,1H2,2-3H3 |
InChI Key | DJTVRBJOMCDZFQ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C12H12O3 |
Molecular Weight | 204.22 g/mol |
Exact Mass | 204.078644241 g/mol |
Topological Polar Surface Area (TPSA) | 31.60 Ų |
XlogP | 3.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4306 | P22460 | Voltage-gated potassium channel subunit Kv1.5 | 93.65% | 94.03% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.91% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.83% | 96.00% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 89.86% | 89.62% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.35% | 95.56% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.74% | 86.33% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 83.24% | 89.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.23% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.05% | 94.45% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 82.61% | 91.49% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 81.49% | 94.00% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.59% | 85.14% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.24% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Dorstenia barnimiana |
PubChem | 14018773 |
LOTUS | LTS0217582 |
wikiData | Q104982824 |