5-[(E)-2-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol
Internal ID | a75886c6-9086-4fa5-9a1e-2049fbb3fde6 |
Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
IUPAC Name | 5-[(E)-2-[4-hydroxy-3,5-bis(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol |
SMILES (Canonical) | CC(=CCC1=CC(=CC(=C1O)CC=C(C)C)C=CC2=CC(=CC(=C2)O)O)C |
SMILES (Isomeric) | CC(=CCC1=CC(=CC(=C1O)CC=C(C)C)/C=C/C2=CC(=CC(=C2)O)O)C |
InChI | InChI=1S/C24H28O3/c1-16(2)5-9-20-11-18(12-21(24(20)27)10-6-17(3)4)7-8-19-13-22(25)15-23(26)14-19/h5-8,11-15,25-27H,9-10H2,1-4H3/b8-7+ |
InChI Key | DSEWUZWKAPKNNQ-BQYQJAHWSA-N |
Popularity | 1 reference in papers |
Molecular Formula | C24H28O3 |
Molecular Weight | 364.50 g/mol |
Exact Mass | 364.20384475 g/mol |
Topological Polar Surface Area (TPSA) | 60.70 Ų |
XlogP | 7.00 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.59% | 91.11% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 94.74% | 91.49% |
CHEMBL3401 | O75469 | Pregnane X receptor | 93.02% | 94.73% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.04% | 96.00% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.27% | 92.68% |
CHEMBL2581 | P07339 | Cathepsin D | 90.16% | 98.95% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.87% | 86.33% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.90% | 96.09% |
CHEMBL3194 | P02766 | Transthyretin | 85.25% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.93% | 99.17% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.72% | 94.45% |
CHEMBL1929 | P47989 | Xanthine dehydrogenase | 84.04% | 96.12% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 80.33% | 91.71% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 101583544 |
LOTUS | LTS0217627 |
wikiData | Q104987807 |