5-Butan-2-yl-3-methoxy-2-methyl-pyrazine
| Internal ID | abf8c58c-5901-4696-8f0e-6006e685c4af |
| Taxonomy | Organoheterocyclic compounds > Diazines > Pyrazines > Methoxypyrazines |
| IUPAC Name | 5-butan-2-yl-3-methoxy-2-methylpyrazine |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C10H16N2O/c1-5-7(2)9-6-11-8(3)10(12-9)13-4/h6-7H,5H2,1-4H3 |
| InChI Key | CQKQPXBHCKUVTC-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.126263138 g/mol |
| Topological Polar Surface Area (TPSA) | 35.00 Ų |
| XlogP | 2.00 |
| SCHEMBL16431745 |
| 5-sec-Butyl-3-methoxy-2-methylpyrazine |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 94.31% | 96.09% |
| CHEMBL235 | P37231 | Peroxisome proliferator-activated receptor gamma | 90.36% | 95.39% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.74% | 93.65% |
| CHEMBL4005 | P42336 | PI3-kinase p110-alpha subunit | 87.75% | 97.47% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 87.70% | 94.73% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 87.58% | 96.00% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.55% | 94.00% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 86.33% | 87.45% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.98% | 94.75% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 84.82% | 93.31% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.70% | 99.17% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 83.76% | 92.68% |
| CHEMBL3714130 | P46095 | G-protein coupled receptor 6 | 80.74% | 97.36% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.35% | 98.75% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11679913 |
| LOTUS | LTS0099472 |
| wikiData | Q77372636 |