5-Benzoyl-4-methoxy-8,8-dimethyl-1,3,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione
Internal ID | 6c566b16-910e-4767-b61a-89577245aac7 |
Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Phenylketones > Alkyl-phenylketones |
IUPAC Name | 5-benzoyl-4-methoxy-8,8-dimethyl-1,3,7-tris(3-methylbut-2-enyl)bicyclo[3.3.1]non-3-ene-2,9-dione |
SMILES (Canonical) | CC(=CCC1CC2(C(=C(C(=O)C(C2=O)(C1(C)C)CC=C(C)C)CC=C(C)C)OC)C(=O)C3=CC=CC=C3)C |
SMILES (Isomeric) | CC(=CCC1CC2(C(=C(C(=O)C(C2=O)(C1(C)C)CC=C(C)C)CC=C(C)C)OC)C(=O)C3=CC=CC=C3)C |
InChI | InChI=1S/C34H44O4/c1-22(2)15-17-26-21-33(28(35)25-13-11-10-12-14-25)30(38-9)27(18-16-23(3)4)29(36)34(31(33)37,32(26,7)8)20-19-24(5)6/h10-16,19,26H,17-18,20-21H2,1-9H3 |
InChI Key | NIIMCEOIHSLVDO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C34H44O4 |
Molecular Weight | 516.70 g/mol |
Exact Mass | 516.32395988 g/mol |
Topological Polar Surface Area (TPSA) | 60.40 Ų |
XlogP | 8.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL221 | P23219 | Cyclooxygenase-1 | 98.70% | 90.17% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.34% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.30% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 94.05% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.62% | 95.56% |
CHEMBL4040 | P28482 | MAP kinase ERK2 | 90.27% | 83.82% |
CHEMBL2581 | P07339 | Cathepsin D | 88.88% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.48% | 94.45% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 85.88% | 95.50% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 84.64% | 85.14% |
CHEMBL2535 | P11166 | Glucose transporter | 83.13% | 98.75% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.03% | 93.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 82.99% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.66% | 99.23% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 82.55% | 91.07% |
CHEMBL5028 | O14672 | ADAM10 | 81.42% | 97.50% |
CHEMBL1821 | P08173 | Muscarinic acetylcholine receptor M4 | 81.22% | 94.08% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.12% | 91.19% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Clusia nemorosa |
PubChem | 78078577 |
LOTUS | LTS0005790 |
wikiData | Q105179830 |