5-Amino-2-trideca-3,5-dienylpiperidin-4-ol
| Internal ID | f1a71745-ba9e-4afe-8887-86bba426e3a0 |
| Taxonomy | Alkaloids and derivatives |
| IUPAC Name | 5-amino-2-trideca-3,5-dienylpiperidin-4-ol |
| SMILES (Canonical) | CCCCCCCC=CC=CCCC1CC(C(CN1)N)O |
| SMILES (Isomeric) | CCCCCCCC=CC=CCCC1CC(C(CN1)N)O |
| InChI | InChI=1S/C18H34N2O/c1-2-3-4-5-6-7-8-9-10-11-12-13-16-14-18(21)17(19)15-20-16/h8-11,16-18,20-21H,2-7,12-15,19H2,1H3 |
| InChI Key | SUCIRJXWHXGMLK-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H34N2O |
| Molecular Weight | 294.50 g/mol |
| Exact Mass | 294.267113712 g/mol |
| Topological Polar Surface Area (TPSA) | 58.30 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 97.94% | 97.09% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 96.73% | 89.63% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 95.78% | 97.79% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.76% | 96.09% |
| CHEMBL2955 | O95136 | Sphingosine 1-phosphate receptor Edg-5 | 94.69% | 92.86% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 94.65% | 90.17% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 93.84% | 98.03% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 93.81% | 97.29% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 93.59% | 91.11% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 93.10% | 96.95% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 91.42% | 85.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 91.37% | 94.45% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 91.18% | 92.08% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 90.98% | 100.00% |
| CHEMBL1907589 | P17787 | Neuronal acetylcholine receptor; alpha4/beta2 | 90.85% | 94.55% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.60% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 90.58% | 99.17% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.37% | 97.25% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 86.86% | 89.34% |
| CHEMBL5043 | Q6P179 | Endoplasmic reticulum aminopeptidase 2 | 86.34% | 91.81% |
| CHEMBL3230 | O95977 | Sphingosine 1-phosphate receptor Edg-6 | 86.11% | 94.01% |
| CHEMBL2885 | P07451 | Carbonic anhydrase III | 85.37% | 87.45% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 84.72% | 92.88% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.64% | 92.94% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 84.62% | 89.62% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.05% | 95.58% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 83.41% | 95.50% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 82.25% | 96.00% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.04% | 90.24% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.54% | 97.21% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 72737862 |
| LOTUS | LTS0082986 |
| wikiData | Q105260791 |