3-Acetyl-6-methylpyridine
| Internal ID | 571e850d-95bf-478d-9f67-dcddec044f25 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbonyl compounds > Aryl ketones > Aryl alkyl ketones |
| IUPAC Name | 1-(6-methyl-3-pyridinyl)ethanone |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C8H9NO/c1-6-3-4-8(5-9-6)7(2)10/h3-5H,1-2H3 |
| InChI Key | PVRYOKQFLBSILA-UHFFFAOYSA-N |
| Popularity | 7 references in papers |
| Molecular Formula | C8H9NO |
| Molecular Weight | 135.16 g/mol |
| Exact Mass | 135.068413911 g/mol |
| Topological Polar Surface Area (TPSA) | 30.00 Ų |
| XlogP | 0.90 |
| 36357-38-7 |
| 1-(6-methylpyridin-3-yl)ethanone |
| 3-Acetyl-6-Methylpyridine |
| 2-Methyl-5-acetylpyridine |
| Ethanone, 1-(6-methyl-3-pyridinyl)- |
| 1-(6-Methylpyridin-3-yl)ethan-1-one |
| 5-Acetyl-2-picoline |
| 1-(6-Methyl-pyridin-3-yl)-ethanone |
| 1-(6-Methyl-3-pyridyl)-1-ethanone |
| 0H4J36GB7B |
| There are more than 10 synonyms. If you wish to see them all click here. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 92.78% | 81.11% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 88.76% | 93.65% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 88.03% | 90.00% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 86.39% | 93.10% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 86.35% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.89% | 94.73% |
| CHEMBL2716 | Q8WUI4 | Histone deacetylase 7 | 81.49% | 89.44% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 81.34% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.98% | 98.75% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 80.84% | 97.21% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 80.74% | 99.17% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 80.42% | 90.24% |
| CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 80.24% | 89.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 95292 |
| LOTUS | LTS0126117 |
| wikiData | Q27236777 |