5-(8-hydroxy-6,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione
Internal ID | d150a10d-20e3-4245-88e4-77a59f5b03c1 |
Taxonomy | Phenylpropanoids and polyketides > Isoflavonoids > Isoflavanquinones |
IUPAC Name | 5-(8-hydroxy-6,7-dimethoxy-3,4-dihydro-2H-chromen-3-yl)-2,3-dimethoxycyclohexa-2,5-diene-1,4-dione |
SMILES (Canonical) | COC1=C(C(=C2C(=C1)CC(CO2)C3=CC(=O)C(=C(C3=O)OC)OC)O)OC |
SMILES (Isomeric) | COC1=C(C(=C2C(=C1)CC(CO2)C3=CC(=O)C(=C(C3=O)OC)OC)O)OC |
InChI | InChI=1S/C19H20O8/c1-23-13-6-9-5-10(8-27-16(9)15(22)18(13)25-3)11-7-12(20)17(24-2)19(26-4)14(11)21/h6-7,10,22H,5,8H2,1-4H3 |
InChI Key | LTSRWUYQDCNOPN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C19H20O8 |
Molecular Weight | 376.40 g/mol |
Exact Mass | 376.11581759 g/mol |
Topological Polar Surface Area (TPSA) | 101.00 Ų |
XlogP | 1.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.07% | 91.11% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.00% | 85.14% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.17% | 95.56% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 93.28% | 94.45% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.58% | 96.09% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.83% | 94.00% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.73% | 89.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.57% | 86.33% |
CHEMBL2581 | P07339 | Cathepsin D | 89.08% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 87.34% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 87.18% | 93.99% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.36% | 100.00% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.97% | 99.23% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.88% | 95.89% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 82.59% | 97.14% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 81.71% | 99.17% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.10% | 92.94% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Abrus precatorius |
PubChem | 85064920 |
LOTUS | LTS0136058 |
wikiData | Q105157151 |