5-[5-(Hydroxymethyl)-6-methyl-4-oxatricyclo[3.3.1.02,7]nonan-2-yl]-2-methyl-4-oxopent-2-enamide
| Internal ID | f0cc4298-504c-4ab2-bd59-ed1f104c2828 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Monoterpenoids > Bicyclic monoterpenoids |
| IUPAC Name | 5-[5-(hydroxymethyl)-6-methyl-4-oxatricyclo[3.3.1.02,7]nonan-2-yl]-2-methyl-4-oxopent-2-enamide |
| SMILES (Canonical) | CC1C2CC3C2(COC1(C3)CO)CC(=O)C=C(C)C(=O)N |
| SMILES (Isomeric) | CC1C2CC3C2(COC1(C3)CO)CC(=O)C=C(C)C(=O)N |
| InChI | InChI=1S/C16H23NO4/c1-9(14(17)20)3-12(19)6-15-8-21-16(7-18)5-11(15)4-13(15)10(16)2/h3,10-11,13,18H,4-8H2,1-2H3,(H2,17,20) |
| InChI Key | LILJBIXCHRHJEL-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16270821 g/mol |
| Topological Polar Surface Area (TPSA) | 89.60 Ų |
| XlogP | 0.10 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.75% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.50% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 94.02% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 92.44% | 97.25% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.47% | 89.34% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.01% | 94.45% |
| CHEMBL203 | P00533 | Epidermal growth factor receptor erbB1 | 87.98% | 97.34% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 87.81% | 96.95% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.78% | 91.19% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 87.43% | 96.61% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 87.00% | 95.50% |
| CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 86.76% | 91.07% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 85.85% | 90.17% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.19% | 92.94% |
| CHEMBL3474 | P14555 | Phospholipase A2 group IIA | 84.65% | 94.05% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 84.34% | 98.75% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.21% | 100.00% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 82.55% | 89.50% |
| CHEMBL4660 | P28907 | Lymphocyte differentiation antigen CD38 | 81.42% | 95.27% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.22% | 89.00% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.87% | 95.93% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.58% | 100.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162904065 |
| LOTUS | LTS0028310 |
| wikiData | Q104170972 |