5-(5-hydroxy-7-methoxy-3-oxo-1H-2-benzofuran-1-yl)-2-prop-1-enyl-1H-pyridin-4-one
| Internal ID | 2feef81c-ae2e-4ff3-a162-3be4d802b79b |
| Taxonomy | Organoheterocyclic compounds > Benzofurans > Benzofuranones |
| IUPAC Name | 5-(5-hydroxy-7-methoxy-3-oxo-1H-2-benzofuran-1-yl)-2-prop-1-enyl-1H-pyridin-4-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C17H15NO5/c1-3-4-9-5-13(20)12(8-18-9)16-15-11(17(21)23-16)6-10(19)7-14(15)22-2/h3-8,16,19H,1-2H3,(H,18,20) |
| InChI Key | NVUHVZUPJHEJGT-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C17H15NO5 |
| Molecular Weight | 313.30 g/mol |
| Exact Mass | 313.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 84.90 Ų |
| XlogP | 1.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.93% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 94.94% | 95.56% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 92.46% | 85.14% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.11% | 89.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.06% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.87% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.81% | 96.09% |
| CHEMBL2535 | P11166 | Glucose transporter | 91.73% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.76% | 94.45% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.92% | 92.94% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 87.78% | 99.23% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 87.60% | 93.03% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 86.55% | 91.49% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.31% | 94.75% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 83.71% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 82.78% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 81.43% | 90.00% |
| CHEMBL3830 | Q2M2I8 | Adaptor-associated kinase | 80.80% | 83.10% |
| CHEMBL3194 | P02766 | Transthyretin | 80.76% | 90.71% |
| CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 80.68% | 95.56% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 162990288 |
| LOTUS | LTS0069650 |
| wikiData | Q105186418 |