5-(5-Hydroxy-6-methylhept-6-en-2-yl)-2-methylphenol
| Internal ID | 4d3148f2-0379-450d-a6ba-0687067fda7f |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 5-(5-hydroxy-6-methylhept-6-en-2-yl)-2-methylphenol |
| SMILES (Canonical) | CC1=C(C=C(C=C1)C(C)CCC(C(=C)C)O)O |
| SMILES (Isomeric) | CC1=C(C=C(C=C1)C(C)CCC(C(=C)C)O)O |
| InChI | InChI=1S/C15H22O2/c1-10(2)14(16)8-6-11(3)13-7-5-12(4)15(17)9-13/h5,7,9,11,14,16-17H,1,6,8H2,2-4H3 |
| InChI Key | CDFYSXHPCPFPAR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.33 g/mol |
| Exact Mass | 234.161979940 g/mol |
| Topological Polar Surface Area (TPSA) | 40.50 Ų |
| XlogP | 3.90 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 96.65% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 94.00% | 94.73% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.86% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.27% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.05% | 96.00% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.80% | 95.56% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.46% | 99.15% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 84.11% | 93.56% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.00% | 97.21% |
| CHEMBL3524 | P56524 | Histone deacetylase 4 | 82.94% | 92.97% |
| CHEMBL4581 | P52732 | Kinesin-like protein 1 | 82.70% | 93.18% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 81.70% | 93.65% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 80.29% | 85.14% |
| CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 80.13% | 93.40% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Iostephane heterophylla |
| PubChem | 162934727 |
| LOTUS | LTS0072802 |
| wikiData | Q104954394 |