5-(4-Hydroxyphenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol
| Internal ID | 042edf99-0864-42e3-bb9e-c3c191cf3c6a |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Biphenyls and derivatives |
| IUPAC Name | 5-(4-hydroxyphenyl)-3-methoxy-2-(3-methylbut-2-enyl)phenol |
| SMILES (Canonical) | CC(=CCC1=C(C=C(C=C1OC)C2=CC=C(C=C2)O)O)C |
| SMILES (Isomeric) | CC(=CCC1=C(C=C(C=C1OC)C2=CC=C(C=C2)O)O)C |
| InChI | InChI=1S/C18H20O3/c1-12(2)4-9-16-17(20)10-14(11-18(16)21-3)13-5-7-15(19)8-6-13/h4-8,10-11,19-20H,9H2,1-3H3 |
| InChI Key | HOJRPRKZNLBIEQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.30 g/mol |
| Exact Mass | 284.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.79% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.92% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 93.12% | 86.33% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.74% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.99% | 99.17% |
| CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 88.95% | 98.11% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 87.24% | 86.92% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 87.10% | 91.71% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.27% | 94.75% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 85.98% | 88.48% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 84.43% | 92.94% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.25% | 94.45% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.62% | 99.15% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 82.85% | 94.00% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 82.45% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 81.91% | 90.71% |
| CHEMBL4355 | O14976 | Serine/threonine-protein kinase GAK | 81.65% | 89.32% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 80.46% | 92.68% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Garcinia linii |
| PubChem | 86057835 |
| LOTUS | LTS0070762 |
| wikiData | Q105031316 |