5-(4-Hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol
Internal ID | 19151f74-c56b-4f00-9e0d-11877f034a52 |
Taxonomy | Lignans, neolignans and related compounds > Aryltetralin lignans |
IUPAC Name | 5-(4-hydroxy-3-methoxyphenyl)-3-methoxy-6,7-dimethyl-5,6,7,8-tetrahydronaphthalen-2-ol |
SMILES (Canonical) | CC1CC2=CC(=C(C=C2C(C1C)C3=CC(=C(C=C3)O)OC)OC)O |
SMILES (Isomeric) | CC1CC2=CC(=C(C=C2C(C1C)C3=CC(=C(C=C3)O)OC)OC)O |
InChI | InChI=1S/C20H24O4/c1-11-7-14-8-17(22)19(24-4)10-15(14)20(12(11)2)13-5-6-16(21)18(9-13)23-3/h5-6,8-12,20-22H,7H2,1-4H3 |
InChI Key | YHPHTNNPOSLWIM-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H24O4 |
Molecular Weight | 328.40 g/mol |
Exact Mass | 328.16745924 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 4.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.63% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.42% | 96.09% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 95.69% | 85.14% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 91.84% | 92.94% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 91.13% | 91.49% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 90.71% | 89.62% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 88.88% | 88.48% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.00% | 97.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.71% | 86.33% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.42% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 87.22% | 95.56% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 87.14% | 91.79% |
CHEMBL2535 | P11166 | Glucose transporter | 85.05% | 98.75% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 84.44% | 99.15% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.95% | 99.17% |
CHEMBL4208 | P20618 | Proteasome component C5 | 82.86% | 90.00% |
CHEMBL2581 | P07339 | Cathepsin D | 82.24% | 98.95% |
CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 82.18% | 96.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Larrea tridentata |
PubChem | 72834187 |
LOTUS | LTS0073814 |
wikiData | Q105348546 |