5-(4-Aminobutyl)-1,5-diazacyclohenicosane-6,15-dione
Internal ID | cd04484f-bd82-41f0-8575-dfbadff3ad29 |
Taxonomy | Phenylpropanoids and polyketides > Macrolactams |
IUPAC Name | 5-(4-aminobutyl)-1,5-diazacyclohenicosane-6,15-dione |
SMILES (Canonical) | C1CCCCC(=O)N(CCCNCCCCCCC(=O)CCC1)CCCCN |
SMILES (Isomeric) | C1CCCCC(=O)N(CCCNCCCCCCC(=O)CCC1)CCCCN |
InChI | InChI=1S/C23H45N3O2/c24-17-10-12-20-26-21-13-19-25-18-11-6-5-8-15-22(27)14-7-3-1-2-4-9-16-23(26)28/h25H,1-21,24H2 |
InChI Key | NEJPUSYTUHUCJN-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C23H45N3O2 |
Molecular Weight | 395.60 g/mol |
Exact Mass | 395.35117769 g/mol |
Topological Polar Surface Area (TPSA) | 75.40 Ų |
XlogP | 3.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.95% | 95.56% |
CHEMBL3384 | Q16512 | Protein kinase N1 | 95.20% | 80.71% |
CHEMBL2581 | P07339 | Cathepsin D | 93.57% | 98.95% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.41% | 96.09% |
CHEMBL4581 | P52732 | Kinesin-like protein 1 | 92.22% | 93.18% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 91.72% | 97.09% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 91.00% | 90.71% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.95% | 95.89% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.18% | 86.33% |
CHEMBL3012 | Q13946 | Phosphodiesterase 7A | 84.15% | 99.29% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.13% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 83.97% | 91.11% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 83.63% | 85.00% |
CHEMBL3105 | P09874 | Poly [ADP-ribose] polymerase-1 | 83.38% | 93.90% |
CHEMBL1978 | P11511 | Cytochrome P450 19A1 | 83.31% | 91.76% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 82.50% | 93.40% |
CHEMBL3492 | P49721 | Proteasome Macropain subunit | 81.15% | 90.24% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Oncinotis tenuiloba |
PubChem | 15215098 |
LOTUS | LTS0168656 |
wikiData | Q105177980 |