[5-[(4-Acetyloxy-6-ethyl-5-methyl-2-oxopyran-3-yl)methyl]-2,3-dimethyl-6-oxopyran-4-yl] acetate
| Internal ID | 667f100e-ffbc-46a6-87a7-d53275f9db06 |
| Taxonomy | Organoheterocyclic compounds > Pyrans > Pyranones and derivatives |
| IUPAC Name | [5-[(4-acetyloxy-6-ethyl-5-methyl-2-oxopyran-3-yl)methyl]-2,3-dimethyl-6-oxopyran-4-yl] acetate |
| SMILES (Canonical) | CCC1=C(C(=C(C(=O)O1)CC2=C(C(=C(OC2=O)C)C)OC(=O)C)OC(=O)C)C |
| SMILES (Isomeric) | CCC1=C(C(=C(C(=O)O1)CC2=C(C(=C(OC2=O)C)C)OC(=O)C)OC(=O)C)C |
| InChI | InChI=1S/C20H22O8/c1-7-16-10(3)18(27-13(6)22)15(20(24)28-16)8-14-17(26-12(5)21)9(2)11(4)25-19(14)23/h7-8H2,1-6H3 |
| InChI Key | MOQDKFWAXSTUFU-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H22O8 |
| Molecular Weight | 390.40 g/mol |
| Exact Mass | 390.13146766 g/mol |
| Topological Polar Surface Area (TPSA) | 105.00 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 91.72% | 98.95% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 90.37% | 89.34% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 86.22% | 96.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.91% | 94.45% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 85.82% | 89.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.70% | 94.73% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 84.63% | 94.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.72% | 99.23% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.20% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 81.47% | 91.11% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Helichrysum arenarium |
| PubChem | 163022073 |
| LOTUS | LTS0072345 |
| wikiData | Q105169075 |