5-(3-Hydroxyprop-1-enyl)-3-methoxybenzene-1,2-diol
Internal ID | 6c9ae29c-71b9-4dab-a92a-8e09c519ab63 |
Taxonomy | Benzenoids > Phenols > Methoxyphenols |
IUPAC Name | 5-(3-hydroxyprop-1-enyl)-3-methoxybenzene-1,2-diol |
SMILES (Canonical) | COC1=CC(=CC(=C1O)O)C=CCO |
SMILES (Isomeric) | COC1=CC(=CC(=C1O)O)C=CCO |
InChI | InChI=1S/C10H12O4/c1-14-9-6-7(3-2-4-11)5-8(12)10(9)13/h2-3,5-6,11-13H,4H2,1H3 |
InChI Key | NPNAJGCZQBQWQZ-UHFFFAOYSA-N |
Popularity | 16 references in papers |
Molecular Formula | C10H12O4 |
Molecular Weight | 196.20 g/mol |
Exact Mass | 196.07355886 g/mol |
Topological Polar Surface Area (TPSA) | 69.90 Ų |
XlogP | 0.90 |
DTXSID501310998 |
Q27158872 |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.57% | 91.11% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 94.28% | 96.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.07% | 96.09% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.50% | 86.33% |
CHEMBL3194 | P02766 | Transthyretin | 90.34% | 90.71% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.03% | 95.56% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.19% | 99.17% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 85.44% | 92.68% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 84.22% | 91.71% |
CHEMBL3401 | O75469 | Pregnane X receptor | 82.58% | 94.73% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 81.49% | 86.92% |
CHEMBL1255126 | O15151 | Protein Mdm4 | 80.90% | 90.20% |
CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.76% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Arabidopsis thaliana |
PubChem | 443704 |
LOTUS | LTS0124018 |
wikiData | Q27158872 |