5-(3-Hydroxyprop-1-enyl)-3-methoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenol
Internal ID | 6fed09c8-45b0-46c3-9fd3-dd9cf991ae00 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 5-(3-hydroxyprop-1-enyl)-3-methoxy-2-(3,7,11-trimethyldodeca-2,6,10-trienoxy)phenol |
SMILES (Canonical) | CC(=CCCC(=CCCC(=CCOC1=C(C=C(C=C1OC)C=CCO)O)C)C)C |
SMILES (Isomeric) | CC(=CCCC(=CCCC(=CCOC1=C(C=C(C=C1OC)C=CCO)O)C)C)C |
InChI | InChI=1S/C25H36O4/c1-19(2)9-6-10-20(3)11-7-12-21(4)14-16-29-25-23(27)17-22(13-8-15-26)18-24(25)28-5/h8-9,11,13-14,17-18,26-27H,6-7,10,12,15-16H2,1-5H3 |
InChI Key | OWYVGANMNUNBLO-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H36O4 |
Molecular Weight | 400.50 g/mol |
Exact Mass | 400.26135963 g/mol |
Topological Polar Surface Area (TPSA) | 58.90 Ų |
XlogP | 6.50 |
There are no found synonyms. |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.60% | 91.11% |
CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 95.25% | 92.08% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 95.02% | 96.00% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.20% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.33% | 96.09% |
CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 90.57% | 92.68% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.35% | 86.33% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.05% | 94.73% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 83.60% | 94.45% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.37% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.25% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.69% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Gypothamnium pinifolium |
PubChem | 163085596 |
LOTUS | LTS0126118 |
wikiData | Q105202402 |