5-[(2S,5R)-5-[(1R)-1-hydroxynonyl]oxolan-2-yl]pentanoic acid
| Internal ID | 611d47e5-5a6d-4f3f-998a-7f63a60704e8 |
| Taxonomy | Organic acids and derivatives > Hydroxy acids and derivatives > Medium-chain hydroxy acids and derivatives |
| IUPAC Name | 5-[(2S,5R)-5-[(1R)-1-hydroxynonyl]oxolan-2-yl]pentanoic acid |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C18H34O4/c1-2-3-4-5-6-7-11-16(19)17-14-13-15(22-17)10-8-9-12-18(20)21/h15-17,19H,2-14H2,1H3,(H,20,21)/t15-,16+,17+/m0/s1 |
| InChI Key | XAYWWYNAKCODPX-GVDBMIGSSA-N |
| Popularity | 2 references in papers |
| Molecular Formula | C18H34O4 |
| Molecular Weight | 314.50 g/mol |
| Exact Mass | 314.24570956 g/mol |
| Topological Polar Surface Area (TPSA) | 66.80 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of 5-[(2S,5R)-5-[(1R)-1-hydroxynonyl]oxolan-2-yl]pentanoic acid](https://plantaedb.com/storage/docs/compounds/2023/11/5-2s5r-5-1r-1-hydroxynonyloxolan-2-ylpentanoic-acid.jpg "2D Structure of 5-[(2S,5R)-5-[(1R)-1-hydroxynonyl]oxolan-2-yl]pentanoic acid")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 97.76% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.26% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 96.30% | 99.17% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 90.97% | 89.63% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.46% | 91.11% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.19% | 93.56% |
| CHEMBL5255 | O00206 | Toll-like receptor 4 | 89.88% | 92.50% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 89.51% | 97.29% |
| CHEMBL2001 | Q9H244 | Purinergic receptor P2Y12 | 88.92% | 96.00% |
| CHEMBL335 | P18031 | Protein-tyrosine phosphatase 1B | 88.86% | 95.17% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.53% | 100.00% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 87.39% | 100.00% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.11% | 97.25% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 86.91% | 91.19% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 85.51% | 92.08% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 84.71% | 96.47% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.54% | 97.09% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 84.10% | 95.50% |
| CHEMBL2265 | P23141 | Acyl coenzyme A:cholesterol acyltransferase | 84.03% | 85.94% |
| CHEMBL1795139 | Q8IU80 | Transmembrane protease serine 6 | 83.11% | 98.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.88% | 94.73% |
| CHEMBL4330 | Q9NS75 | Cysteinyl leukotriene receptor 2 | 82.68% | 98.00% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 82.18% | 83.82% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 81.36% | 95.89% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 80.94% | 90.71% |
| CHEMBL2514 | O95665 | Neurotensin receptor 2 | 80.92% | 100.00% |
| CHEMBL1944495 | P28065 | Proteasome subunit beta type-9 | 80.65% | 97.50% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 80.64% | 93.31% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.50% | 93.00% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 80.33% | 90.24% |
| CHEMBL237 | P41145 | Kappa opioid receptor | 80.28% | 98.10% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 11255482 |
| LOTUS | LTS0217739 |
| wikiData | Q105324240 |