5-[(2R,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol
| Internal ID | 447d85d7-6219-4832-9885-1704002e29ea |
| Taxonomy | Lignans, neolignans and related compounds > Furanoid lignans > Tetrahydrofuran lignans > 7,8-epoxylignans |
| IUPAC Name | 5-[(2R,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol |
| SMILES (Canonical) | C1=CC(=CC=C1C2C(C(C(O2)C3=CC=C(C=C3)O)C4=CC(=CC(=C4)O)O)C5=CC(=CC(=C5)O)O)O |
| SMILES (Isomeric) | C1=CC(=CC=C1[C@H]2[C@H]([C@@H]([C@H](O2)C3=CC=C(C=C3)O)C4=CC(=CC(=C4)O)O)C5=CC(=CC(=C5)O)O)O |
| InChI | InChI=1S/C28H24O7/c29-19-5-1-15(2-6-19)27-25(17-9-21(31)13-22(32)10-17)26(18-11-23(33)14-24(34)12-18)28(35-27)16-3-7-20(30)8-4-16/h1-14,25-34H/t25-,26-,27-,28+/m0/s1 |
| InChI Key | IRMTUHFNJGIEEV-LAJGZZDBSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C28H24O7 |
| Molecular Weight | 472.50 g/mol |
| Exact Mass | 472.15220310 g/mol |
| Topological Polar Surface Area (TPSA) | 131.00 Ų |
| XlogP | 4.30 |
| There are no found synonyms. |
![2D Structure of 5-[(2R,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/5-2r3r4r5s-4-35-dihydroxyphenyl-25-bis4-hydroxyphenyloxolan-3-ylbenzene-13-diol.jpg "2D Structure of 5-[(2R,3R,4R,5S)-4-(3,5-dihydroxyphenyl)-2,5-bis(4-hydroxyphenyl)oxolan-3-yl]benzene-1,3-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 97.80% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 90.96% | 91.49% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.48% | 94.73% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 84.08% | 98.35% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.52% | 97.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.66% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 81.59% | 86.33% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.52% | 89.00% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 80.47% | 90.93% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 80.07% | 95.93% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Parthenocissus tricuspidata |
| PubChem | 132504659 |
| LOTUS | LTS0132413 |
| wikiData | Q105118961 |