5-(2,4a,5,5-Tetramethyl-1,4,6,7,8,8a-hexahydronaphthalen-1-yl)-3-methylpent-2-en-1-ol
| Internal ID | 97d3f9b1-8180-49a5-a8cd-649fda0777f9 |
| Taxonomy | Lipids and lipid-like molecules > Fatty Acyls > Fatty alcohols |
| IUPAC Name | 5-(2,4a,5,5-tetramethyl-1,4,6,7,8,8a-hexahydronaphthalen-1-yl)-3-methylpent-2-en-1-ol |
| SMILES (Canonical) | CC1=CCC2(C(C1CCC(=CCO)C)CCCC2(C)C)C |
| SMILES (Isomeric) | CC1=CCC2(C(C1CCC(=CCO)C)CCCC2(C)C)C |
| InChI | InChI=1S/C20H34O/c1-15(11-14-21)8-9-17-16(2)10-13-20(5)18(17)7-6-12-19(20,3)4/h10-11,17-18,21H,6-9,12-14H2,1-5H3 |
| InChI Key | FFFJTXJWPXZCHV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H34O |
| Molecular Weight | 290.50 g/mol |
| Exact Mass | 290.260965704 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 5.80 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.40% | 97.25% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.29% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 90.33% | 91.11% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 87.00% | 100.00% |
| CHEMBL4187 | Q99250 | Sodium channel protein type II alpha subunit | 86.53% | 95.50% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.33% | 97.09% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 85.79% | 97.79% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.40% | 95.56% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 84.32% | 94.75% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.20% | 95.89% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 81.99% | 100.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 80.91% | 98.95% |
| CHEMBL1871 | P10275 | Androgen Receptor | 80.71% | 96.43% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Brachyglottis bidwillii |
| PubChem | 162925000 |
| LOTUS | LTS0082596 |
| wikiData | Q104994426 |