5-(2-Phenylethenyl)furan-2-carboxylic acid
| Internal ID | 6b453cf8-a583-4845-9366-a12000fc0def |
| Taxonomy | Organoheterocyclic compounds > Furans > Furoic acid and derivatives > Furoic acids |
| IUPAC Name | 5-(2-phenylethenyl)furan-2-carboxylic acid |
| SMILES (Canonical) | C1=CC=C(C=C1)C=CC2=CC=C(O2)C(=O)O |
| SMILES (Isomeric) | C1=CC=C(C=C1)C=CC2=CC=C(O2)C(=O)O |
| InChI | InChI=1S/C13H10O3/c14-13(15)12-9-8-11(16-12)7-6-10-4-2-1-3-5-10/h1-9H,(H,14,15) |
| InChI Key | QOLLEHPWMIUKOR-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.062994177 g/mol |
| Topological Polar Surface Area (TPSA) | 50.40 Ų |
| XlogP | 3.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1293294 | P51151 | Ras-related protein Rab-9A | 93.40% | 87.67% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.13% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.29% | 91.11% |
| CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 91.57% | 94.62% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 88.78% | 86.33% |
| CHEMBL1293277 | O15118 | Niemann-Pick C1 protein | 88.44% | 81.11% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 87.12% | 83.57% |
| CHEMBL3194 | P02766 | Transthyretin | 87.10% | 90.71% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 86.91% | 96.00% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 86.82% | 95.50% |
| CHEMBL3492 | P49721 | Proteasome Macropain subunit | 86.00% | 90.24% |
| CHEMBL3902 | P09211 | Glutathione S-transferase Pi | 84.34% | 93.81% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.20% | 98.95% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 83.69% | 93.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.88% | 94.73% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 82.19% | 99.17% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.25% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Renealmia nicolaioides |
| PubChem | 131332862 |
| LOTUS | LTS0160080 |
| wikiData | Q105224975 |