5-[2-(Furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid
Internal ID | 7b53215c-c71c-41b4-addc-f75a3004cf06 |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Diterpenoids > Colensane and clerodane diterpenoids |
IUPAC Name | 5-[2-(furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid |
SMILES (Canonical) | CC1CCC2=C(C1(C)CC(=O)C3=COC=C3)CCCC2(C)C(=O)O |
SMILES (Isomeric) | CC1CCC2=C(C1(C)CC(=O)C3=COC=C3)CCCC2(C)C(=O)O |
InChI | InChI=1S/C20H26O4/c1-13-6-7-16-15(5-4-9-19(16,2)18(22)23)20(13,3)11-17(21)14-8-10-24-12-14/h8,10,12-13H,4-7,9,11H2,1-3H3,(H,22,23) |
InChI Key | UYLPOJLFURHUGB-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C20H26O4 |
Molecular Weight | 330.40 g/mol |
Exact Mass | 330.18310931 g/mol |
Topological Polar Surface Area (TPSA) | 67.50 Ų |
XlogP | 3.30 |
There are no found synonyms. |
![2D Structure of 5-[2-(Furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid 2D Structure of 5-[2-(Furan-3-yl)-2-oxoethyl]-1,5,6-trimethyl-2,3,4,6,7,8-hexahydronaphthalene-1-carboxylic acid](https://plantaedb.com/storage/docs/compounds/2023/11/5-2-furan-3-yl-2-oxoethyl-156-trimethyl-234678-hexahydronaphthalene-1-carboxylic-acid.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 95.45% | 96.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 93.83% | 90.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.66% | 86.33% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 88.03% | 95.56% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 87.68% | 97.25% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.38% | 91.11% |
CHEMBL2581 | P07339 | Cathepsin D | 83.97% | 98.95% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.90% | 97.09% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.97% | 99.23% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 82.18% | 89.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 82.01% | 90.71% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 81.73% | 100.00% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.71% | 95.89% |
CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 80.25% | 93.04% |
CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 80.02% | 93.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Chrozophora oblongifolia |
PubChem | 85127450 |
LOTUS | LTS0149360 |
wikiData | Q105281634 |