5-[2-(4-Hydroxyphenyl)ethyl-methylamino]-2-methoxyphenol
| Internal ID | 9d521d3a-aa78-4aac-bc88-14a6d7974e82 |
| Taxonomy | Benzenoids > Phenols > Methoxyphenols |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethyl-methylamino]-2-methoxyphenol |
| SMILES (Canonical) | CN(CCC1=CC=C(C=C1)O)C2=CC(=C(C=C2)OC)O |
| SMILES (Isomeric) | CN(CCC1=CC=C(C=C1)O)C2=CC(=C(C=C2)OC)O |
| InChI | InChI=1S/C16H19NO3/c1-17(10-9-12-3-6-14(18)7-4-12)13-5-8-16(20-2)15(19)11-13/h3-8,11,18-19H,9-10H2,1-2H3 |
| InChI Key | MFQRLRUURRGUOV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C16H19NO3 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.13649347 g/mol |
| Topological Polar Surface Area (TPSA) | 52.90 Ų |
| XlogP | 3.30 |
| There are no found synonyms. |
![2D Structure of 5-[2-(4-Hydroxyphenyl)ethyl-methylamino]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-2-4-hydroxyphenylethyl-methylamino-2-methoxyphenol.jpg "2D Structure of 5-[2-(4-Hydroxyphenyl)ethyl-methylamino]-2-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.75% | 96.09% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.27% | 98.95% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 94.24% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.18% | 99.17% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.31% | 86.33% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.89% | 94.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 88.38% | 93.99% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.36% | 91.11% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 85.84% | 90.00% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.37% | 98.75% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 84.80% | 95.89% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 83.69% | 96.09% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.30% | 95.89% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.83% | 94.73% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 80.11% | 96.95% |
| CHEMBL2424 | Q04760 | Glyoxalase I | 80.09% | 91.67% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Pancratium maritimum |
| PubChem | 69610924 |
| LOTUS | LTS0096510 |
| wikiData | Q105162957 |