5-[2-(4-Hydroxy-phenyl)-ethyl]-2,3-dimethoxy-phenol
| Internal ID | 518a154e-2aee-4f2c-b608-ba663727a8cc |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethyl]-2,3-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=CC(=C1OC)O)CCC2=CC=C(C=C2)O |
| SMILES (Isomeric) | COC1=CC(=CC(=C1OC)O)CCC2=CC=C(C=C2)O |
| InChI | InChI=1S/C16H18O4/c1-19-15-10-12(9-14(18)16(15)20-2)4-3-11-5-7-13(17)8-6-11/h5-10,17-18H,3-4H2,1-2H3 |
| InChI Key | ITWQAPOXXSJIAS-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C16H18O4 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.40 |
| There are no found synonyms. |
![2D Structure of 5-[2-(4-Hydroxy-phenyl)-ethyl]-2,3-dimethoxy-phenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-2-4-hydroxyphenylethyl-23-dimethoxyphenol.jpg "2D Structure of 5-[2-(4-Hydroxy-phenyl)-ethyl]-2,3-dimethoxy-phenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.94% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 95.36% | 91.11% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.31% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.78% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 90.30% | 86.33% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.88% | 98.75% |
| CHEMBL1966 | Q02127 | Dihydroorotate dehydrogenase | 89.08% | 96.09% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.74% | 94.45% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 87.55% | 94.00% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 86.99% | 90.20% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.11% | 90.00% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.53% | 95.89% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.35% | 96.95% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 84.31% | 92.68% |
| CHEMBL3194 | P02766 | Transthyretin | 82.15% | 90.71% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 80.69% | 93.99% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Combretum apiculatum |
| Combretum molle |
| Combretum psidioides |
| PubChem | 22753767 |
| LOTUS | LTS0196984 |
| wikiData | Q105120335 |