5-[2-(4-Hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enoxy)benzene-1,3-diol
| Internal ID | 5731309d-e145-4a4c-a12e-879d850f1dc6 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[2-(4-hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enoxy)benzene-1,3-diol |
| SMILES (Canonical) | CC(=CCOC1=C(C=C(C=C1O)C=CC2=CC=C(C=C2)O)O)C |
| SMILES (Isomeric) | CC(=CCOC1=C(C=C(C=C1O)C=CC2=CC=C(C=C2)O)O)C |
| InChI | InChI=1S/C19H20O4/c1-13(2)9-10-23-19-17(21)11-15(12-18(19)22)4-3-14-5-7-16(20)8-6-14/h3-9,11-12,20-22H,10H2,1-2H3 |
| InChI Key | SHDVQVBZYNRISV-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C19H20O4 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.13615911 g/mol |
| Topological Polar Surface Area (TPSA) | 69.90 Ų |
| XlogP | 4.60 |
| There are no found synonyms. |
![2D Structure of 5-[2-(4-Hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enoxy)benzene-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/5-2-4-hydroxyphenylethenyl-2-3-methylbut-2-enoxybenzene-13-diol.jpg "2D Structure of 5-[2-(4-Hydroxyphenyl)ethenyl]-2-(3-methylbut-2-enoxy)benzene-1,3-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.72% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 94.11% | 91.49% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 91.56% | 96.00% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 91.08% | 94.73% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.83% | 86.33% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 88.07% | 93.10% |
| CHEMBL2581 | P07339 | Cathepsin D | 87.98% | 98.95% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.96% | 99.17% |
| CHEMBL3194 | P02766 | Transthyretin | 87.77% | 90.71% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.73% | 92.68% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 87.02% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 86.92% | 96.09% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.19% | 90.00% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 83.65% | 98.35% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.43% | 89.00% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 81.11% | 99.15% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 80.87% | 89.62% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artocarpus altilis |
| PubChem | 129847915 |
| LOTUS | LTS0196718 |
| wikiData | Q105252905 |