5-[2-[4-Hydroxy-3-(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol
| Internal ID | fc383ca4-9ff1-46bc-a3fd-113a937a7ed2 |
| Taxonomy | Phenylpropanoids and polyketides > Stilbenes |
| IUPAC Name | 5-[2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C19H20O3/c1-13(2)3-7-16-9-14(6-8-19(16)22)4-5-15-10-17(20)12-18(21)11-15/h3-6,8-12,20-22H,7H2,1-2H3 |
| InChI Key | BWCJJGGZRYKPID-UHFFFAOYSA-N |
| Popularity | 3 references in papers |
| Molecular Formula | C19H20O3 |
| Molecular Weight | 296.40 g/mol |
| Exact Mass | 296.14124450 g/mol |
| Topological Polar Surface Area (TPSA) | 60.70 Ų |
| XlogP | 5.10 |
| There are no found synonyms. |
![2D Structure of 5-[2-[4-Hydroxy-3-(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol](https://plantaedb.com/storage/docs/compounds/2023/11/5-2-4-hydroxy-3-3-methylbut-2-enylphenylethenylbenzene-13-diol.jpg "2D Structure of 5-[2-[4-Hydroxy-3-(3-methylbut-2-enyl)phenyl]ethenyl]benzene-1,3-diol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.84% | 91.11% |
| CHEMBL1951 | P21397 | Monoamine oxidase A | 97.29% | 91.49% |
| CHEMBL1929 | P47989 | Xanthine dehydrogenase | 94.93% | 96.12% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 93.97% | 96.00% |
| CHEMBL3194 | P02766 | Transthyretin | 92.40% | 90.71% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.10% | 86.33% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 92.08% | 94.73% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.14% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.24% | 94.45% |
| CHEMBL215 | P09917 | Arachidonate 5-lipoxygenase | 87.01% | 92.68% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 85.39% | 99.15% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 85.09% | 95.56% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.63% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 83.14% | 99.17% |
| CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 82.96% | 91.71% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 82.47% | 95.93% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.63% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Artocarpus lacucha |
| PubChem | 78200706 |
| LOTUS | LTS0113284 |
| wikiData | Q104947107 |