5-[(1R,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol
| Internal ID | 0ac6fed9-dd61-4dcb-b9fd-f95db0cbc670 |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | 5-[(1R,5S)-3,5-dibromo-2,2-dimethyl-6-methylidenecyclohexyl]-3-methylpent-1-en-3-ol |
| SMILES (Canonical) | CC1(C(CC(C(=C)C1CCC(C)(C=C)O)Br)Br)C |
| SMILES (Isomeric) | CC1([C@H](C(=C)[C@H](CC1Br)Br)CCC(C)(C=C)O)C |
| InChI | InChI=1S/C15H24Br2O/c1-6-15(5,18)8-7-11-10(2)12(16)9-13(17)14(11,3)4/h6,11-13,18H,1-2,7-9H2,3-5H3/t11-,12-,13?,15?/m0/s1 |
| InChI Key | DKTCDYQKNAKCBB-YKQCJFHZSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24Br2O |
| Molecular Weight | 380.16 g/mol |
| Exact Mass | 380.01734 g/mol |
| Topological Polar Surface Area (TPSA) | 20.20 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 92.64% | 90.93% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.54% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 91.20% | 96.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 89.38% | 97.25% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 86.59% | 97.79% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.42% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 85.95% | 96.95% |
| CHEMBL2581 | P07339 | Cathepsin D | 82.83% | 98.95% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 82.77% | 94.73% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.68% | 96.43% |
| CHEMBL1293267 | Q9HC97 | G-protein coupled receptor 35 | 82.58% | 89.34% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.81% | 95.56% |
| CHEMBL1841 | P06241 | Tyrosine-protein kinase FYN | 80.17% | 81.29% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 163185192 |
| LOTUS | LTS0083298 |
| wikiData | Q104983737 |