5-(1H-indol-3-ylmethylidene)-1-methyl-2-(methylamino)imidazol-4-one
| Internal ID | 2dd265e7-22e7-4051-b51b-5fa31b48c996 |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 5-(1H-indol-3-ylmethylidene)-1-methyl-2-(methylamino)imidazol-4-one |
| SMILES (Canonical) | CNC1=NC(=O)C(=CC2=CNC3=CC=CC=C32)N1C |
| SMILES (Isomeric) | CNC1=NC(=O)C(=CC2=CNC3=CC=CC=C32)N1C |
| InChI | InChI=1S/C14H14N4O/c1-15-14-17-13(19)12(18(14)2)7-9-8-16-11-6-4-3-5-10(9)11/h3-8,16H,1-2H3,(H,15,17,19) |
| InChI Key | UVIKYYAHZODERH-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H14N4O |
| Molecular Weight | 254.29 g/mol |
| Exact Mass | 254.11676108 g/mol |
| Topological Polar Surface Area (TPSA) | 60.50 Ų |
| XlogP | 1.50 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 98.08% | 91.49% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 97.36% | 95.56% |
| CHEMBL2581 | P07339 | Cathepsin D | 95.06% | 98.95% |
| CHEMBL2095172 | P14867 | GABA-A receptor; alpha-1/beta-2/gamma-2 | 91.64% | 92.67% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 90.65% | 98.59% |
| CHEMBL2095226 | P05556 | Integrin alpha-5/beta-1 | 86.28% | 96.39% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 86.21% | 94.00% |
| CHEMBL3055 | P50613 | Cyclin-dependent kinase 7 | 86.13% | 81.88% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 85.58% | 94.73% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.41% | 99.23% |
| CHEMBL308 | P06493 | Cyclin-dependent kinase 1 | 83.83% | 91.73% |
| CHEMBL4225 | P49760 | Dual specificity protein kinase CLK2 | 82.57% | 80.96% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 82.41% | 96.09% |
| CHEMBL3310 | Q96DB2 | Histone deacetylase 11 | 81.50% | 88.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 80.91% | 86.33% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 80.77% | 94.45% |
| CHEMBL2535 | P11166 | Glucose transporter | 80.62% | 98.75% |
| CHEMBL222 | P23975 | Norepinephrine transporter | 80.31% | 96.06% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.06% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 5488700 |
| LOTUS | LTS0075856 |
| wikiData | Q105279888 |