5-(1,5-Dimethyl-4-hexenyl)-2-methylene-3-cyclo-hexanol
Internal ID | 884eddbf-30bb-44d8-9144-5e531b3045bd |
Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
IUPAC Name | 5-(6-methylhept-5-en-2-yl)-2-methylidenecyclohexan-1-ol |
SMILES (Canonical) | CC(CCC=C(C)C)C1CCC(=C)C(C1)O |
SMILES (Isomeric) | CC(CCC=C(C)C)C1CCC(=C)C(C1)O |
InChI | InChI=1S/C15H26O/c1-11(2)6-5-7-12(3)14-9-8-13(4)15(16)10-14/h6,12,14-16H,4-5,7-10H2,1-3H3 |
InChI Key | SKAUBXZIXVGASZ-UHFFFAOYSA-N |
Popularity | 0 references in papers |
Molecular Formula | C15H26O |
Molecular Weight | 222.37 g/mol |
Exact Mass | 222.198365449 g/mol |
Topological Polar Surface Area (TPSA) | 20.20 Ų |
XlogP | 4.30 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.55% | 94.45% |
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 88.59% | 91.11% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.20% | 95.93% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.05% | 97.25% |
CHEMBL2581 | P07339 | Cathepsin D | 87.85% | 98.95% |
CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 85.66% | 95.58% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.65% | 95.89% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 84.41% | 97.09% |
CHEMBL221 | P23219 | Cyclooxygenase-1 | 84.24% | 90.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 84.18% | 96.09% |
CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 83.95% | 93.56% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.94% | 100.00% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 80.59% | 91.49% |
CHEMBL1907598 | P05106 | Integrin alpha-V/beta-3 | 80.32% | 95.71% |
CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.13% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Zingiber officinale |
PubChem | 139291555 |
LOTUS | LTS0074008 |
wikiData | Q105254701 |