5-(10,10-Dibromo-3-hydroxydeca-1,9-dienyl)oxolan-2-one
| Internal ID | e1787b9f-1318-4434-89e2-377eea3d17b9 |
| Taxonomy | Organoheterocyclic compounds > Lactones > Gamma butyrolactones |
| IUPAC Name | 5-(10,10-dibromo-3-hydroxydeca-1,9-dienyl)oxolan-2-one |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C14H20Br2O3/c15-13(16)6-4-2-1-3-5-11(17)7-8-12-9-10-14(18)19-12/h6-8,11-12,17H,1-5,9-10H2 |
| InChI Key | MZAQGPQBEPVOJJ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C14H20Br2O3 |
| Molecular Weight | 396.11 g/mol |
| Exact Mass | 395.97587 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 4.00 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.85% | 91.11% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 93.48% | 93.99% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.25% | 90.08% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 92.14% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 90.32% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.04% | 95.56% |
| CHEMBL1829 | O15379 | Histone deacetylase 3 | 89.28% | 95.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.71% | 96.09% |
| CHEMBL4227 | P25090 | Lipoxin A4 receptor | 87.05% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 86.45% | 94.75% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 86.13% | 97.09% |
| CHEMBL325 | Q13547 | Histone deacetylase 1 | 82.42% | 95.92% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.76% | 89.00% |
| CHEMBL3807 | P17706 | T-cell protein-tyrosine phosphatase | 81.56% | 93.00% |
| CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 80.70% | 96.47% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 75599677 |
| LOTUS | LTS0221666 |
| wikiData | Q105175336 |