5-(1-Bromoprop-2-ynyl)-2-[(3,5-dibromo-6-ethyloxan-2-yl)methyl]oxolan-3-ol
| Internal ID | b763a2df-60d3-41db-a4b2-bf84bd4d4f57 |
| Taxonomy | Organic oxygen compounds > Organooxygen compounds > Carbohydrates and carbohydrate conjugates > Glycosyl compounds > C-glycosyl compounds |
| IUPAC Name | 5-(1-bromoprop-2-ynyl)-2-[(3,5-dibromo-6-ethyloxan-2-yl)methyl]oxolan-3-ol |
| SMILES (Canonical) | |
| SMILES (Isomeric) | |
| InChI | InChI=1S/C15H21Br3O3/c1-3-8(16)13-6-11(19)15(21-13)7-14-10(18)5-9(17)12(4-2)20-14/h1,8-15,19H,4-7H2,2H3 |
| InChI Key | OJOGNQPBRRLKKS-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H21Br3O3 |
| Molecular Weight | 489.00 g/mol |
| Exact Mass | 487.90203 g/mol |
| Topological Polar Surface Area (TPSA) | 38.70 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.21% | 96.09% |
| CHEMBL221 | P23219 | Cyclooxygenase-1 | 95.38% | 90.17% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 93.66% | 95.93% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 93.27% | 97.25% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 92.36% | 96.61% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 91.44% | 91.11% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.71% | 97.09% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 89.15% | 96.95% |
| CHEMBL6136 | O60341 | Lysine-specific histone demethylase 1 | 84.72% | 95.58% |
| CHEMBL4657 | Q6V1X1 | Dipeptidyl peptidase VIII | 83.81% | 97.21% |
| CHEMBL3145 | P42338 | PI3-kinase p110-beta subunit | 81.32% | 98.75% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 81.04% | 92.62% |
| CHEMBL2996 | Q05655 | Protein kinase C delta | 80.48% | 97.79% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 14412601 |
| LOTUS | LTS0173111 |
| wikiData | Q105193177 |