5-[1-(4-Hydroxyphenyl)prop-2-en-1-yl]-2,3,4-trimethoxyphenol
| Internal ID | da7e9ef3-3b1d-4bb1-9e9c-95e8881ed759 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
| IUPAC Name | 5-[1-(4-hydroxyphenyl)prop-2-enyl]-2,3,4-trimethoxyphenol |
| SMILES (Canonical) | COC1=C(C(=C(C=C1C(C=C)C2=CC=C(C=C2)O)O)OC)OC |
| SMILES (Isomeric) | COC1=C(C(=C(C=C1C(C=C)C2=CC=C(C=C2)O)O)OC)OC |
| InChI | InChI=1S/C18H20O5/c1-5-13(11-6-8-12(19)9-7-11)14-10-15(20)17(22-3)18(23-4)16(14)21-2/h5-10,13,19-20H,1H2,2-4H3 |
| InChI Key | YMGWJOIJYYZHCV-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H20O5 |
| Molecular Weight | 316.30 g/mol |
| Exact Mass | 316.13107373 g/mol |
| Topological Polar Surface Area (TPSA) | 68.20 Ų |
| XlogP | 3.60 |
| 5-[1-(4-Hydroxyphenyl)prop-2-en-1-yl]-2,3,4-trimethoxyphenol |
| 21044-87-1 |
![2D Structure of 5-[1-(4-Hydroxyphenyl)prop-2-en-1-yl]-2,3,4-trimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-1-4-hydroxyphenylprop-2-en-1-yl-234-trimethoxyphenol.jpg "2D Structure of 5-[1-(4-Hydroxyphenyl)prop-2-en-1-yl]-2,3,4-trimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.48% | 91.11% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 92.37% | 94.45% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.34% | 98.35% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 90.47% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 86.92% | 99.17% |
| CHEMBL2581 | P07339 | Cathepsin D | 84.07% | 98.95% |
| CHEMBL245 | P20309 | Muscarinic acetylcholine receptor M3 | 83.61% | 97.53% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 83.44% | 86.33% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 83.32% | 90.00% |
| CHEMBL211 | P08172 | Muscarinic acetylcholine receptor M2 | 82.75% | 94.97% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 80.82% | 95.56% |
| CHEMBL1907594 | P30926 | Neuronal acetylcholine receptor; alpha3/beta4 | 80.21% | 97.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 53438933 |
| LOTUS | LTS0122509 |
| wikiData | Q82633331 |