5-[1-(4-Hydroxyphenyl)penta-1,4-dien-3-yl]-2-methoxyphenol
| Internal ID | ab81c30d-51ab-4968-996e-9c28230f9cf5 |
| Taxonomy | Lignans, neolignans and related compounds |
| IUPAC Name | 5-[1-(4-hydroxyphenyl)penta-1,4-dien-3-yl]-2-methoxyphenol |
| SMILES (Canonical) | COC1=C(C=C(C=C1)C(C=C)C=CC2=CC=C(C=C2)O)O |
| SMILES (Isomeric) | COC1=C(C=C(C=C1)C(C=C)C=CC2=CC=C(C=C2)O)O |
| InChI | InChI=1S/C18H18O3/c1-3-14(7-4-13-5-9-16(19)10-6-13)15-8-11-18(21-2)17(20)12-15/h3-12,14,19-20H,1H2,2H3 |
| InChI Key | QGQNWQZNFRNVLW-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.125594432 g/mol |
| Topological Polar Surface Area (TPSA) | 49.70 Ų |
| XlogP | 4.40 |
| There are no found synonyms. |
![2D Structure of 5-[1-(4-Hydroxyphenyl)penta-1,4-dien-3-yl]-2-methoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-1-4-hydroxyphenylpenta-14-dien-3-yl-2-methoxyphenol.jpg "2D Structure of 5-[1-(4-Hydroxyphenyl)penta-1,4-dien-3-yl]-2-methoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL1951 | P21397 | Monoamine oxidase A | 95.07% | 91.49% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 94.90% | 91.11% |
| CHEMBL3194 | P02766 | Transthyretin | 94.08% | 90.71% |
| CHEMBL242 | Q92731 | Estrogen receptor beta | 92.62% | 98.35% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.11% | 96.09% |
| CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 92.06% | 96.00% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 91.98% | 86.33% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 91.72% | 89.62% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 91.21% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.93% | 99.17% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.29% | 95.56% |
| CHEMBL2535 | P11166 | Glucose transporter | 89.28% | 98.75% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 88.77% | 94.45% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 86.98% | 93.99% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 86.19% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 85.25% | 98.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Asparagus cochinchinensis |
| PubChem | 72796735 |
| LOTUS | LTS0072725 |
| wikiData | Q105220562 |