5-[[1-[(4-hydroxyphenyl)methyl]-4-[(4-methoxyphenyl)methyl]imidazol-2-yl]amino]imidazole-2,4-dione
| Internal ID | bc2b7e7e-d5fa-4705-ba6e-a53f559df11e |
| Taxonomy | Organic acids and derivatives > Carboxylic acids and derivatives > Amino acids, peptides, and analogues > Alpha amino acids and derivatives |
| IUPAC Name | 5-[[1-[(4-hydroxyphenyl)methyl]-4-[(4-methoxyphenyl)methyl]imidazol-2-yl]amino]imidazole-2,4-dione |
| SMILES (Canonical) | COC1=CC=C(C=C1)CC2=CN(C(=N2)NC3=NC(=O)NC3=O)CC4=CC=C(C=C4)O |
| SMILES (Isomeric) | COC1=CC=C(C=C1)CC2=CN(C(=N2)NC3=NC(=O)NC3=O)CC4=CC=C(C=C4)O |
| InChI | InChI=1S/C21H19N5O4/c1-30-17-8-4-13(5-9-17)10-15-12-26(11-14-2-6-16(27)7-3-14)20(22-15)23-18-19(28)25-21(29)24-18/h2-9,12,27H,10-11H2,1H3,(H2,22,23,24,25,28,29) |
| InChI Key | DUVWQFLGSQEPQQ-UHFFFAOYSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H19N5O4 |
| Molecular Weight | 405.40 g/mol |
| Exact Mass | 405.14370410 g/mol |
| Topological Polar Surface Area (TPSA) | 118.00 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.41% | 94.45% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 97.19% | 96.09% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 96.64% | 94.00% |
| CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.02% | 85.14% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 95.36% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 94.11% | 90.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 93.27% | 98.95% |
| CHEMBL2107 | P61073 | C-X-C chemokine receptor type 4 | 93.08% | 93.10% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 92.08% | 91.11% |
| CHEMBL4303 | P08238 | Heat shock protein HSP 90-beta | 90.04% | 96.77% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 89.33% | 99.15% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 87.11% | 95.89% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 86.54% | 92.29% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.83% | 86.33% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 84.57% | 85.00% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 82.81% | 91.03% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 81.43% | 90.71% |
| CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 81.32% | 95.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 478881 |
| LOTUS | LTS0080959 |
| wikiData | Q104989482 |