5-[1-(3-Hy droxyphenyl)-2-propenyl]-2,4-dimethoxyphenol
| Internal ID | bb41bd61-dcc1-4d5b-9c17-c6fe01b68d12 |
| Taxonomy | Benzenoids > Benzene and substituted derivatives > Diphenylmethanes |
| IUPAC Name | 5-[1-(3-hydroxyphenyl)prop-2-enyl]-2,4-dimethoxyphenol |
| SMILES (Canonical) | COC1=CC(=C(C=C1C(C=C)C2=CC(=CC=C2)O)O)OC |
| SMILES (Isomeric) | COC1=CC(=C(C=C1C(C=C)C2=CC(=CC=C2)O)O)OC |
| InChI | InChI=1S/C17H18O4/c1-4-13(11-6-5-7-12(18)8-11)14-9-15(19)17(21-3)10-16(14)20-2/h4-10,13,18-19H,1H2,2-3H3 |
| InChI Key | QPMNRZAZYQAWCN-UHFFFAOYSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C17H18O4 |
| Molecular Weight | 286.32 g/mol |
| Exact Mass | 286.12050905 g/mol |
| Topological Polar Surface Area (TPSA) | 58.90 Ų |
| XlogP | 3.70 |
| There are no found synonyms. |
![2D Structure of 5-[1-(3-Hy droxyphenyl)-2-propenyl]-2,4-dimethoxyphenol](https://plantaedb.com/storage/docs/compounds/2023/11/5-1-3-hy-droxyphenyl-2-propenyl-24-dimethoxyphenol.jpg "2D Structure of 5-[1-(3-Hy droxyphenyl)-2-propenyl]-2,4-dimethoxyphenol")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.52% | 91.11% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.89% | 96.09% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.32% | 95.56% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 92.85% | 86.33% |
| CHEMBL2581 | P07339 | Cathepsin D | 91.28% | 98.95% |
| CHEMBL2535 | P11166 | Glucose transporter | 90.73% | 98.75% |
| CHEMBL1255126 | O15151 | Protein Mdm4 | 88.15% | 90.20% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.74% | 99.17% |
| CHEMBL1907 | P15144 | Aminopeptidase N | 86.23% | 93.31% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 85.85% | 89.62% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.51% | 94.45% |
| CHEMBL2146302 | O94925 | Glutaminase kidney isoform, mitochondrial | 84.02% | 100.00% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 82.70% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Dalbergia cultrata |
| PubChem | 74977396 |
| LOTUS | LTS0224070 |
| wikiData | Q105225493 |