(4Z,9R)-2,2,5,9-tetramethyl-1,7,8,9-tetrahydrocyclopenta[8]annulene-3,6-dione
| Internal ID | 857e425e-84c6-4906-a524-a6532e6a326a |
| Taxonomy | Lipids and lipid-like molecules > Prenol lipids > Sesquiterpenoids |
| IUPAC Name | (4Z,9R)-2,2,5,9-tetramethyl-1,7,8,9-tetrahydrocyclopenta[8]annulene-3,6-dione |
| SMILES (Canonical) | CC1CCC(=O)C(=CC2=C1CC(C2=O)(C)C)C |
| SMILES (Isomeric) | C[C@@H]1CCC(=O)/C(=C\C2=C1CC(C2=O)(C)C)/C |
| InChI | InChI=1S/C15H20O2/c1-9-5-6-13(16)10(2)7-11-12(9)8-15(3,4)14(11)17/h7,9H,5-6,8H2,1-4H3/b10-7-/t9-/m1/s1 |
| InChI Key | PFDJAISCVCEYSA-SBMLRHLQSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H20O2 |
| Molecular Weight | 232.32 g/mol |
| Exact Mass | 232.146329876 g/mol |
| Topological Polar Surface Area (TPSA) | 34.10 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
![2D Structure of (4Z,9R)-2,2,5,9-tetramethyl-1,7,8,9-tetrahydrocyclopenta[8]annulene-3,6-dione](https://plantaedb.com/storage/docs/compounds/2023/11/4z9r-2259-tetramethyl-1789-tetrahydrocyclopenta8annulene-36-dione.jpg "2D Structure of (4Z,9R)-2,2,5,9-tetramethyl-1,7,8,9-tetrahydrocyclopenta[8]annulene-3,6-dione")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 95.71% | 89.63% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.76% | 95.56% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 89.35% | 92.94% |
| CHEMBL2581 | P07339 | Cathepsin D | 89.28% | 98.95% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.86% | 96.09% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.14% | 91.11% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.57% | 94.75% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.97% | 93.99% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 83.54% | 97.25% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.61% | 100.00% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 82.21% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 81.97% | 97.09% |
| CHEMBL3351 | Q13085 | Acetyl-CoA carboxylase 1 | 81.26% | 93.04% |
| CHEMBL1871 | P10275 | Androgen Receptor | 81.19% | 96.43% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.18% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 73352240 |
| LOTUS | LTS0185537 |
| wikiData | Q105207671 |