(4S,6S)-4-hydroxy-6-pentadecyloxan-2-one
| Internal ID | 906e43cc-f04c-4aa9-ab1d-980bc09bb6af |
| Taxonomy | Organoheterocyclic compounds > Lactones > Delta valerolactones |
| IUPAC Name | (4S,6S)-4-hydroxy-6-pentadecyloxan-2-one |
| SMILES (Canonical) | CCCCCCCCCCCCCCCC1CC(CC(=O)O1)O |
| SMILES (Isomeric) | CCCCCCCCCCCCCCC[C@H]1C[C@@H](CC(=O)O1)O |
| InChI | InChI=1S/C20H38O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-19-16-18(21)17-20(22)23-19/h18-19,21H,2-17H2,1H3/t18-,19-/m0/s1 |
| InChI Key | OLCJEHKFBLFZBD-OALUTQOASA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C20H38O3 |
| Molecular Weight | 326.50 g/mol |
| Exact Mass | 326.28209507 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 7.40 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2996 | Q05655 | Protein kinase C delta | 94.63% | 97.79% |
| CHEMBL299 | P17252 | Protein kinase C alpha | 93.26% | 98.03% |
| CHEMBL2581 | P07339 | Cathepsin D | 92.27% | 98.95% |
| CHEMBL230 | P35354 | Cyclooxygenase-2 | 92.22% | 89.63% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 89.72% | 96.09% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.75% | 97.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.55% | 99.17% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 87.42% | 91.11% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 85.27% | 97.25% |
| CHEMBL4769 | O95749 | Geranylgeranyl pyrophosphate synthetase | 84.94% | 92.08% |
| CHEMBL2274 | Q9H228 | Sphingosine 1-phosphate receptor Edg-8 | 84.26% | 100.00% |
| CHEMBL3892 | Q99500 | Sphingosine 1-phosphate receptor Edg-3 | 83.91% | 97.29% |
| CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 82.43% | 96.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 82.12% | 95.56% |
| CHEMBL4462 | Q8IXJ6 | NAD-dependent deacetylase sirtuin 2 | 81.05% | 90.24% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 80.50% | 99.23% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Hymenoxys odorata |
| Hymenoxys richardsonii |
| PubChem | 14488531 |
| LOTUS | LTS0113135 |
| wikiData | Q105193909 |