(4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one
| Internal ID | 0a00e1a5-b837-47b2-80d3-08f8c4827317 |
| Taxonomy | Organoheterocyclic compounds > Dihydrofurans > Furanones > Butenolides |
| IUPAC Name | (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one |
| SMILES (Canonical) | CC(=C)C1CCC2=COC=CC3=C2C1OC3=O |
| SMILES (Isomeric) | CC(=C)[C@@H]1CCC2=COC=CC3=C2[C@H]1OC3=O |
| InChI | InChI=1S/C14H14O3/c1-8(2)10-4-3-9-7-16-6-5-11-12(9)13(10)17-14(11)15/h5-7,10,13H,1,3-4H2,2H3/t10-,13-/m0/s1 |
| InChI Key | WQBPKDLBMOJPGG-GWCFXTLKSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C14H14O3 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.094294304 g/mol |
| Topological Polar Surface Area (TPSA) | 35.50 Ų |
| XlogP | 1.90 |
| (9s,9As)-7,8,9,9a-tetrahydro-9-(1-methylvinyl)-2H-furo[4,3,2-ef][2]benzoxepin-2-one |
![2D Structure of (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one](https://plantaedb.com/storage/docs/compounds/2023/11/4s5s-5-prop-1-en-2-yl-310-dioxatricyclo6410413trideca-113811-trien-2-one.jpg "2D Structure of (4S,5S)-5-prop-1-en-2-yl-3,10-dioxatricyclo[6.4.1.04,13]trideca-1(13),8,11-trien-2-one")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 92.27% | 98.95% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.63% | 95.56% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 86.59% | 91.11% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 86.24% | 83.82% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 85.98% | 99.23% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 83.70% | 97.09% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 83.32% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 80.49% | 96.09% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 90474399 |
| LOTUS | LTS0125584 |
| wikiData | Q105310315 |