(4S)-4-(5,7-dihydroxy-2-methyl-4-oxochromen-6-yl)piperidin-2-one
| Internal ID | cf257d95-857b-4076-8816-ec3bbea4d997 |
| Taxonomy | Organoheterocyclic compounds > Benzopyrans > 1-benzopyrans > Chromones |
| IUPAC Name | (4S)-4-(5,7-dihydroxy-2-methyl-4-oxochromen-6-yl)piperidin-2-one |
| SMILES (Canonical) | CC1=CC(=O)C2=C(O1)C=C(C(=C2O)C3CCNC(=O)C3)O |
| SMILES (Isomeric) | CC1=CC(=O)C2=C(O1)C=C(C(=C2O)[C@H]3CCNC(=O)C3)O |
| InChI | InChI=1S/C15H15NO5/c1-7-4-9(17)14-11(21-7)6-10(18)13(15(14)20)8-2-3-16-12(19)5-8/h4,6,8,18,20H,2-3,5H2,1H3,(H,16,19)/t8-/m0/s1 |
| InChI Key | OSKBDOFSQINPHC-QMMMGPOBSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C15H15NO5 |
| Molecular Weight | 289.28 g/mol |
| Exact Mass | 289.09502258 g/mol |
| Topological Polar Surface Area (TPSA) | 95.90 Ų |
| XlogP | 1.20 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.40% | 91.11% |
| CHEMBL2581 | P07339 | Cathepsin D | 96.43% | 98.95% |
| CHEMBL1293255 | P15428 | 15-hydroxyprostaglandin dehydrogenase [NAD+] | 95.86% | 83.57% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.88% | 89.00% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 91.95% | 93.99% |
| CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 90.87% | 94.00% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.13% | 97.09% |
| CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 88.91% | 99.23% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.34% | 90.71% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 88.22% | 94.73% |
| CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 88.17% | 85.11% |
| CHEMBL3880 | P07900 | Heat shock protein HSP 90-alpha | 85.71% | 96.21% |
| CHEMBL5409 | Q8TDU6 | G-protein coupled bile acid receptor 1 | 85.70% | 93.65% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 85.34% | 94.45% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 84.70% | 95.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 83.95% | 95.89% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 82.62% | 100.00% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 82.18% | 94.75% |
| CHEMBL4803 | P29474 | Nitric-oxide synthase, endothelial | 81.94% | 86.00% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 81.67% | 92.94% |
| CHEMBL2094127 | P06493 | Cyclin-dependent kinase 1/cyclin B | 80.33% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Schumanniophyton problematicum |
| PubChem | 163069945 |
| LOTUS | LTS0131620 |
| wikiData | Q105199020 |