(4R,6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-ol
| Internal ID | 55600290-6e2f-4617-959a-1c5fdd7a3616 |
| Taxonomy | Alkaloids and derivatives > Aporphines |
| IUPAC Name | (4R,6aS)-1,2,9,10-tetramethoxy-6-methyl-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinolin-4-ol |
| SMILES (Canonical) | CN1CC(C2=CC(=C(C3=C2C1CC4=CC(=C(C=C43)OC)OC)OC)OC)O |
| SMILES (Isomeric) | CN1C[C@@H](C2=CC(=C(C3=C2[C@@H]1CC4=CC(=C(C=C43)OC)OC)OC)OC)O |
| InChI | InChI=1S/C21H25NO5/c1-22-10-15(23)13-9-18(26-4)21(27-5)20-12-8-17(25-3)16(24-2)7-11(12)6-14(22)19(13)20/h7-9,14-15,23H,6,10H2,1-5H3/t14-,15-/m0/s1 |
| InChI Key | XFQYJNINHLZMIU-GJZGRUSLSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C21H25NO5 |
| Molecular Weight | 371.40 g/mol |
| Exact Mass | 371.17327290 g/mol |
| Topological Polar Surface Area (TPSA) | 60.40 Ų |
| XlogP | 2.30 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 99.00% | 96.09% |
| CHEMBL217 | P14416 | Dopamine D2 receptor | 96.13% | 95.62% |
| CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 93.05% | 91.79% |
| CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.29% | 91.00% |
| CHEMBL2581 | P07339 | Cathepsin D | 88.75% | 98.95% |
| CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 87.83% | 86.33% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 87.68% | 99.17% |
| CHEMBL225 | P28335 | Serotonin 2c (5-HT2c) receptor | 86.70% | 89.62% |
| CHEMBL5469 | Q14289 | Protein tyrosine kinase 2 beta | 86.19% | 91.03% |
| CHEMBL2535 | P11166 | Glucose transporter | 85.90% | 98.75% |
| CHEMBL241 | Q14432 | Phosphodiesterase 3A | 85.72% | 92.94% |
| CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 85.13% | 95.89% |
| CHEMBL5747 | Q92793 | CREB-binding protein | 84.84% | 95.12% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 84.20% | 95.89% |
| CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 84.15% | 93.99% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 81.61% | 89.00% |
| CHEMBL3438 | Q05513 | Protein kinase C zeta | 81.61% | 88.48% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.45% | 95.56% |
| CHEMBL4208 | P20618 | Proteasome component C5 | 80.79% | 90.00% |
| CHEMBL2069156 | Q14145 | Kelch-like ECH-associated protein 1 | 80.66% | 82.38% |
| CHEMBL4247 | Q9UM73 | ALK tyrosine kinase receptor | 80.33% | 96.86% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Glaucium flavum |
| PubChem | 12302522 |
| LOTUS | LTS0100474 |
| wikiData | Q105327207 |