(4R)-4-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]cyclohexene-1-carbaldehyde
| Internal ID | 71a7e0cd-4e53-4875-9850-68a09e723b21 |
| Taxonomy | Organoheterocyclic compounds > Tetrahydrofurans |
| IUPAC Name | (4R)-4-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]cyclohexene-1-carbaldehyde |
| SMILES (Canonical) | CC1(CCC(O1)C(C)(C)O)C2CCC(=CC2)C=O |
| SMILES (Isomeric) | C[C@@]1(CC[C@H](O1)C(C)(C)O)[C@@H]2CCC(=CC2)C=O |
| InChI | InChI=1S/C15H24O3/c1-14(2,17)13-8-9-15(3,18-13)12-6-4-11(10-16)5-7-12/h4,10,12-13,17H,5-9H2,1-3H3/t12-,13-,15+/m0/s1 |
| InChI Key | APVCGYYDRRKEGD-KCQAQPDRSA-N |
| Popularity | 0 references in papers |
| Molecular Formula | C15H24O3 |
| Molecular Weight | 252.35 g/mol |
| Exact Mass | 252.17254462 g/mol |
| Topological Polar Surface Area (TPSA) | 46.50 Ų |
| XlogP | 1.80 |
| There are no found synonyms. |
![2D Structure of (4R)-4-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]cyclohexene-1-carbaldehyde](https://plantaedb.com/storage/docs/compounds/2023/11/4r-4-2r5s-5-2-hydroxypropan-2-yl-2-methyloxolan-2-ylcyclohexene-1-carbaldehyde.jpg "2D Structure of (4R)-4-[(2R,5S)-5-(2-hydroxypropan-2-yl)-2-methyloxolan-2-yl]cyclohexene-1-carbaldehyde")
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| No predicted properties yet! | |||
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 96.20% | 97.25% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 96.01% | 91.11% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 93.24% | 95.56% |
| CHEMBL1994 | P08235 | Mineralocorticoid receptor | 89.11% | 100.00% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 87.10% | 96.09% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 84.81% | 89.00% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 84.46% | 94.45% |
| CHEMBL1871 | P10275 | Androgen Receptor | 82.12% | 96.43% |
| CHEMBL218 | P21554 | Cannabinoid CB1 receptor | 81.94% | 96.61% |
| CHEMBL5028 | O14672 | ADAM10 | 81.68% | 97.50% |
| CHEMBL3401 | O75469 | Pregnane X receptor | 81.16% | 94.73% |
| CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 80.38% | 100.00% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 80.10% | 93.56% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 80.10% | 95.89% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| Gochnatia vernonioides |
| Pleiotaxis rugosa |
| PubChem | 162874355 |
| LOTUS | LTS0072256 |
| wikiData | Q104916565 |