4H-Dibenzo(de,g)quinoline-2,7-diol, 5,6,6a,7-tetrahydro-1-methoxy-, (6aS,7R)-
Internal ID | 28cfd9a3-80c4-464e-8895-025ccf1e9131 |
Taxonomy | Alkaloids and derivatives > Aporphines > Hydroxy-7-aporphines |
IUPAC Name | (6aS,7R)-1-methoxy-5,6,6a,7-tetrahydro-4H-dibenzo[de,g]quinoline-2,7-diol |
SMILES (Canonical) | COC1=C(C=C2CCNC3C2=C1C4=CC=CC=C4C3O)O |
SMILES (Isomeric) | COC1=C(C=C2CCN[C@H]3C2=C1C4=CC=CC=C4[C@H]3O)O |
InChI | InChI=1S/C17H17NO3/c1-21-17-12(19)8-9-6-7-18-15-13(9)14(17)10-4-2-3-5-11(10)16(15)20/h2-5,8,15-16,18-20H,6-7H2,1H3/t15-,16+/m0/s1 |
InChI Key | QDXOCDFPAQQYKD-JKSUJKDBSA-N |
Popularity | 0 references in papers |
Molecular Formula | C17H17NO3 |
Molecular Weight | 283.32 g/mol |
Exact Mass | 283.12084340 g/mol |
Topological Polar Surface Area (TPSA) | 61.70 Ų |
XlogP | 1.50 |
77410-38-9 |
DTXSID20228123 |

Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.13% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.20% | 96.09% |
CHEMBL2581 | P07339 | Cathepsin D | 95.82% | 98.95% |
CHEMBL2041 | P07949 | Tyrosine-protein kinase receptor RET | 92.80% | 91.79% |
CHEMBL2535 | P11166 | Glucose transporter | 92.47% | 98.75% |
CHEMBL213 | P08588 | Beta-1 adrenergic receptor | 92.33% | 95.56% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.86% | 91.49% |
CHEMBL2056 | P21728 | Dopamine D1 receptor | 89.09% | 91.00% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 88.90% | 97.09% |
CHEMBL3192 | Q9BY41 | Histone deacetylase 8 | 85.07% | 93.99% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.36% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 84.30% | 99.17% |
CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 83.46% | 99.15% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 82.97% | 95.89% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 81.56% | 95.56% |
CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 81.41% | 93.03% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.54% | 90.00% |
CHEMBL3438 | Q05513 | Protein kinase C zeta | 80.53% | 88.48% |
CHEMBL5028 | O14672 | ADAM10 | 80.46% | 97.50% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 80.40% | 89.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Cananga odorata |
Magnolia officinalis |
PubChem | 157059 |
LOTUS | LTS0071058 |
wikiData | Q83108055 |