[(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate
Internal ID | eddd39c8-a9b1-45e6-bc40-e2a2e0dbbd14 |
Taxonomy | Lipids and lipid-like molecules > Steroids and steroid derivatives > Steroidal glycosides |
IUPAC Name | [(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate |
SMILES (Canonical) | CC1C(C(CC(O1)OC2C(OC(CC2OC)OC3C(OC(CC3OC)OC4C(OC(CC4OC)OC5CCC6(C7CC(C8(C(CCC8(C7(CC=C6C5)O)O)C(=O)C)C)OC(=O)C=C(C)C(C)C)C)C)C)C)OC)O |
SMILES (Isomeric) | C[C@H]1[C@@H]([C@@H](C[C@@H](O1)O[C@@H]2[C@H](O[C@H](C[C@H]2OC)O[C@@H]3[C@H](O[C@H](C[C@@H]3OC)O[C@@H]4[C@H](O[C@H](C[C@@H]4OC)O[C@H]5CC[C@@]6([C@H]7C[C@H]([C@@]8([C@@H](CC[C@@]8([C@@]7(CC=C6C5)O)O)C(=O)C)C)OC(=O)/C=C(\C)/C(C)C)C)C)C)C)OC)O |
InChI | InChI=1S/C56H90O18/c1-28(2)29(3)21-44(58)71-43-27-42-53(9)18-16-36(22-35(53)15-19-55(42,60)56(61)20-17-37(30(4)57)54(43,56)10)70-45-24-39(63-12)50(32(6)67-45)73-47-26-41(65-14)52(34(8)69-47)74-48-25-40(64-13)51(33(7)68-48)72-46-23-38(62-11)49(59)31(5)66-46/h15,21,28,31-34,36-43,45-52,59-61H,16-20,22-27H2,1-14H3/b29-21+/t31-,32+,33+,34+,36-,37-,38+,39-,40+,41-,42+,43+,45-,46-,47-,48-,49-,50+,51+,52+,53-,54-,55-,56+/m0/s1 |
InChI Key | FKENLMKIJFNLBM-FNFVBILPSA-N |
Popularity | 0 references in papers |
Molecular Formula | C56H90O18 |
Molecular Weight | 1051.30 g/mol |
Exact Mass | 1050.61271602 g/mol |
Topological Polar Surface Area (TPSA) | 215.00 Ų |
XlogP | 4.80 |
There are no found synonyms. |
![2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate 2D Structure of [(3S,8S,9R,10R,12R,13S,14R,17R)-17-acetyl-8,14-dihydroxy-3-[(2R,4S,5R,6R)-5-[(2S,4S,5R,6R)-5-[(2S,4R,5R,6R)-5-[(2S,4R,5S,6S)-5-hydroxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-4-methoxy-6-methyloxan-2-yl]oxy-10,13-dimethyl-2,3,4,7,9,11,12,15,16,17-decahydro-1H-cyclopenta[a]phenanthren-12-yl] (E)-3,4-dimethylpent-2-enoate](https://plantaedb.com/storage/docs/compounds/2023/11/4fbb9680-863c-11ee-b8f7-fd3f7887a6bf.jpg)
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.75% | 91.11% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 98.29% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 94.16% | 89.00% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 94.00% | 100.00% |
CHEMBL2581 | P07339 | Cathepsin D | 93.61% | 98.95% |
CHEMBL2007 | P16234 | Platelet-derived growth factor receptor alpha | 90.91% | 91.07% |
CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 90.65% | 97.25% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.32% | 94.45% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 89.38% | 95.56% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 88.40% | 95.89% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 88.00% | 92.62% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 87.79% | 95.89% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 87.10% | 95.93% |
CHEMBL255 | P29275 | Adenosine A2b receptor | 86.30% | 98.59% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.62% | 97.09% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 85.53% | 89.50% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 85.45% | 96.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 85.24% | 86.33% |
CHEMBL2335 | P42785 | Lysosomal Pro-X carboxypeptidase | 84.76% | 100.00% |
CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 84.58% | 97.14% |
CHEMBL5028 | O14672 | ADAM10 | 83.71% | 97.50% |
CHEMBL4051 | P13569 | Cystic fibrosis transmembrane conductance regulator | 83.25% | 95.71% |
CHEMBL4227 | P25090 | Lipoxin A4 receptor | 82.85% | 100.00% |
CHEMBL3130 | O00329 | PI3-kinase p110-delta subunit | 82.12% | 96.47% |
CHEMBL340 | P08684 | Cytochrome P450 3A4 | 81.55% | 91.19% |
CHEMBL4208 | P20618 | Proteasome component C5 | 80.07% | 90.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Orthosia guilleminiana |
PubChem | 10748611 |
LOTUS | LTS0201216 |
wikiData | Q104996558 |