[3-[[(2S)-2-(butanoylamino)propanoyl]amino]-4-[[(2S,5S,8S,11R,12S,15S,18R,21R)-5-[(3-chloro-4-hydroxyphenyl)methyl]-21-hydroxy-2-(1-hydroxyethyl)-4,11-dimethyl-15-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-4-oxobutan-2-yl] (2S)-2-(butanoylamino)propanoate
| Internal ID | 0d2fa150-a7c7-4845-87ea-6ccc36d4f9c9 |
| Taxonomy | Organic acids and derivatives > Peptidomimetics > Depsipeptides > Cyclic depsipeptides |
| IUPAC Name | [3-[[(2S)-2-(butanoylamino)propanoyl]amino]-4-[[(2S,5S,8S,11R,12S,15S,18R,21R)-5-[(3-chloro-4-hydroxyphenyl)methyl]-21-hydroxy-2-(1-hydroxyethyl)-4,11-dimethyl-15-(2-methylpropyl)-3,6,9,13,16,22-hexaoxo-8-propan-2-yl-10-oxa-1,4,7,14,17-pentazabicyclo[16.3.1]docosan-12-yl]amino]-4-oxobutan-2-yl] (2S)-2-(butanoylamino)propanoate |
| SMILES (Canonical) | CCCC(=O)NC(C)C(=O)NC(C(C)OC(=O)C(C)NC(=O)CCC)C(=O)NC1C(OC(=O)C(NC(=O)C(N(C(=O)C(N2C(CCC(C2=O)NC(=O)C(NC1=O)CC(C)C)O)C(C)O)C)CC3=CC(=C(C=C3)O)Cl)C(C)C)C |
| SMILES (Isomeric) | CCCC(=O)N[C@@H](C)C(=O)NC(C(C)OC(=O)[C@H](C)NC(=O)CCC)C(=O)N[C@H]1[C@H](OC(=O)[C@@H](NC(=O)[C@@H](N(C(=O)[C@@H](N2[C@@H](CC[C@H](C2=O)NC(=O)[C@@H](NC1=O)CC(C)C)O)C(C)O)C)CC3=CC(=C(C=C3)O)Cl)C(C)C)C |
| InChI | InChI=1S/C52H80ClN9O16/c1-13-15-37(65)54-26(7)44(68)59-42(29(10)77-51(75)27(8)55-38(66)16-14-2)48(72)60-41-30(11)78-52(76)40(25(5)6)58-46(70)35(23-31-17-19-36(64)32(53)22-31)61(12)50(74)43(28(9)63)62-39(67)20-18-33(49(62)73)56-45(69)34(21-24(3)4)57-47(41)71/h17,19,22,24-30,33-35,39-43,63-64,67H,13-16,18,20-21,23H2,1-12H3,(H,54,65)(H,55,66)(H,56,69)(H,57,71)(H,58,70)(H,59,68)(H,60,72)/t26-,27-,28?,29?,30+,33+,34-,35-,39+,40-,41-,42?,43-/m0/s1 |
| InChI Key | KEOLGCFLKHISHR-SDKJDEFNSA-N |
| Popularity | 1 reference in papers |
| Molecular Formula | C52H80ClN9O16 |
| Molecular Weight | 1122.70 g/mol |
| Exact Mass | 1121.5411552 g/mol |
| Topological Polar Surface Area (TPSA) | 358.00 Ų |
| XlogP | 3.30 |
| Atomic LogP (AlogP) | -0.28 |
| H-Bond Acceptor | 16 |
| H-Bond Donor | 10 |
| Rotatable Bonds | 19 |
| There are no found synonyms. |
| Target | Value | Probability (raw) | Probability (%) |
|---|---|---|---|
| Human Intestinal Absorption | + | 0.8509 | 85.09% |
| Caco-2 | - | 0.8623 | 86.23% |
| Blood Brain Barrier | - | 0.8500 | 85.00% |
| Human oral bioavailability | - | 0.7286 | 72.86% |
| Subcellular localzation | Lysosomes | 0.4891 | 48.91% |
| OATP2B1 inhibitior | - | 0.8588 | 85.88% |
| OATP1B1 inhibitior | + | 0.8038 | 80.38% |
| OATP1B3 inhibitior | + | 0.9232 | 92.32% |
| MATE1 inhibitior | - | 0.8200 | 82.00% |
| OCT2 inhibitior | - | 0.8140 | 81.40% |
| BSEP inhibitior | + | 0.9490 | 94.90% |
| P-glycoprotein inhibitior | + | 0.7406 | 74.06% |
| P-glycoprotein substrate | + | 0.8720 | 87.20% |
| CYP3A4 substrate | + | 0.7482 | 74.82% |
| CYP2C9 substrate | - | 0.8018 | 80.18% |
| CYP2D6 substrate | - | 0.8442 | 84.42% |
| CYP3A4 inhibition | - | 0.7424 | 74.24% |
| CYP2C9 inhibition | - | 0.8005 | 80.05% |
| CYP2C19 inhibition | - | 0.7658 | 76.58% |
| CYP2D6 inhibition | - | 0.8534 | 85.34% |
| CYP1A2 inhibition | - | 0.8133 | 81.33% |
| CYP2C8 inhibition | + | 0.8039 | 80.39% |
| CYP inhibitory promiscuity | - | 0.8918 | 89.18% |
| UGT catelyzed | + | 0.7000 | 70.00% |
| Carcinogenicity (binary) | - | 0.7200 | 72.00% |
| Carcinogenicity (trinary) | Non-required | 0.5471 | 54.71% |
| Eye corrosion | - | 0.9865 | 98.65% |
| Eye irritation | - | 0.8987 | 89.87% |
| Skin irritation | - | 0.7879 | 78.79% |
| Skin corrosion | - | 0.9285 | 92.85% |
| Ames mutagenesis | - | 0.5882 | 58.82% |
| Human Ether-a-go-go-Related Gene inhibition | - | 0.3796 | 37.96% |
| Micronuclear | + | 0.9100 | 91.00% |
| Hepatotoxicity | + | 0.5375 | 53.75% |
| skin sensitisation | - | 0.8661 | 86.61% |
| Respiratory toxicity | + | 0.8889 | 88.89% |
| Reproductive toxicity | + | 0.8444 | 84.44% |
| Mitochondrial toxicity | + | 0.9000 | 90.00% |
| Nephrotoxicity | - | 0.7842 | 78.42% |
| Acute Oral Toxicity (c) | III | 0.6584 | 65.84% |
| Estrogen receptor binding | + | 0.7868 | 78.68% |
| Androgen receptor binding | + | 0.7307 | 73.07% |
| Thyroid receptor binding | + | 0.5636 | 56.36% |
| Glucocorticoid receptor binding | + | 0.6023 | 60.23% |
| Aromatase binding | + | 0.6445 | 64.45% |
| PPAR gamma | + | 0.8166 | 81.66% |
| Honey bee toxicity | - | 0.6875 | 68.75% |
| Biodegradation | - | 0.8000 | 80.00% |
| Crustacea aquatic toxicity | + | 0.5949 | 59.49% |
| Fish aquatic toxicity | + | 0.9213 | 92.13% |
Proven Targets:
| CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
|---|---|---|---|---|---|
| No proven targets yet! | |||||
Predicted Targets (via Super-PRED):
| CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
|---|---|---|---|---|
| CHEMBL2581 | P07339 | Cathepsin D | 99.92% | 98.95% |
| CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 99.57% | 94.45% |
| CHEMBL4040 | P28482 | MAP kinase ERK2 | 99.55% | 83.82% |
| CHEMBL4072 | P07858 | Cathepsin B | 98.39% | 93.67% |
| CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 98.37% | 91.11% |
| CHEMBL4835 | P00338 | L-lactate dehydrogenase A chain | 97.49% | 95.34% |
| CHEMBL333 | P08253 | Matrix metalloproteinase-2 | 96.59% | 96.31% |
| CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 96.08% | 96.09% |
| CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 93.73% | 99.17% |
| CHEMBL5103 | Q969S8 | Histone deacetylase 10 | 92.86% | 90.08% |
| CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 92.52% | 95.56% |
| CHEMBL3976 | Q9UHL4 | Dipeptidyl peptidase II | 92.32% | 92.29% |
| CHEMBL255 | P29275 | Adenosine A2b receptor | 92.30% | 98.59% |
| CHEMBL2000 | P03952 | Plasma kallikrein | 92.20% | 93.92% |
| CHEMBL1949 | P62937 | Cyclophilin A | 92.17% | 98.57% |
| CHEMBL5163 | Q9NY46 | Sodium channel protein type III alpha subunit | 91.76% | 96.90% |
| CHEMBL1907600 | Q00535 | Cyclin-dependent kinase 5/CDK5 activator 1 | 91.55% | 93.03% |
| CHEMBL4478 | Q00975 | Voltage-gated N-type calcium channel alpha-1B subunit | 91.40% | 97.14% |
| CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 90.98% | 95.89% |
| CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 90.90% | 89.50% |
| CHEMBL226 | P30542 | Adenosine A1 receptor | 90.84% | 95.93% |
| CHEMBL3359 | P21462 | Formyl peptide receptor 1 | 90.72% | 93.56% |
| CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 90.40% | 89.00% |
| CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 90.01% | 85.00% |
| CHEMBL2094135 | Q96BI3 | Gamma-secretase | 89.80% | 98.05% |
| CHEMBL1907605 | P24864 | Cyclin-dependent kinase 2/cyclin E1 | 89.66% | 92.88% |
| CHEMBL3137262 | O60341 | LSD1/CoREST complex | 89.11% | 97.09% |
| CHEMBL253 | P34972 | Cannabinoid CB2 receptor | 88.90% | 97.25% |
| CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 88.34% | 90.71% |
| CHEMBL340 | P08684 | Cytochrome P450 3A4 | 87.66% | 91.19% |
| CHEMBL3837 | P07711 | Cathepsin L | 87.36% | 96.61% |
| CHEMBL5966 | P55899 | IgG receptor FcRn large subunit p51 | 86.52% | 90.93% |
| CHEMBL1860 | P10827 | Thyroid hormone receptor alpha | 86.36% | 99.15% |
| CHEMBL321 | P14780 | Matrix metalloproteinase 9 | 85.76% | 92.12% |
| CHEMBL1937 | Q92769 | Histone deacetylase 2 | 85.56% | 94.75% |
| CHEMBL2072 | P35499 | Sodium channel protein type IV alpha subunit | 85.02% | 92.32% |
| CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 84.87% | 92.62% |
| CHEMBL4588 | P22894 | Matrix metalloproteinase 8 | 84.65% | 94.66% |
| CHEMBL4296 | Q15858 | Sodium channel protein type IX alpha subunit | 84.48% | 96.11% |
| CHEMBL3384 | Q16512 | Protein kinase N1 | 83.93% | 80.71% |
| CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 82.95% | 86.92% |
| CHEMBL5314 | Q06418 | Tyrosine-protein kinase receptor TYRO3 | 82.66% | 96.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
| There are no matching plants. |
| PubChem | 139585201 |
| LOTUS | LTS0225696 |
| wikiData | Q77385674 |