[(2R,3S,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate
Internal ID | f96ea4a9-a46a-431a-b6e6-487e8d85f044 |
Taxonomy | Phenylpropanoids and polyketides > Cinnamic acids and derivatives > Hydroxycinnamic acids and derivatives > Hydroxycinnamic acid esters > Coumaric acid esters |
IUPAC Name | [(2R,3S,4S,5R,6S)-6-[(2R,3R,4R,5R,6R)-2-[2-(3,4-dihydroxyphenyl)ethoxy]-5-[(E)-3-(3,4-dihydroxyphenyl)prop-2-enoyl]oxy-3-hydroxy-6-(hydroxymethyl)oxan-4-yl]oxy-3,4,5-trihydroxyoxan-2-yl]methyl (E)-3-(4-hydroxyphenyl)prop-2-enoate |
SMILES (Canonical) | C1=CC(=CC=C1C=CC(=O)OCC2C(C(C(C(O2)OC3C(C(OC(C3OC(=O)C=CC4=CC(=C(C=C4)O)O)CO)OCCC5=CC(=C(C=C5)O)O)O)O)O)O)O |
SMILES (Isomeric) | C1=CC(=CC=C1/C=C/C(=O)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H]3[C@H]([C@@H](O[C@@H]([C@H]3OC(=O)/C=C/C4=CC(=C(C=C4)O)O)CO)OCCC5=CC(=C(C=C5)O)O)O)O)O)O)O |
InChI | InChI=1S/C38H42O18/c39-17-27-35(55-30(46)12-6-20-3-9-23(41)25(43)15-20)36(34(50)37(53-27)51-14-13-21-4-10-24(42)26(44)16-21)56-38-33(49)32(48)31(47)28(54-38)18-52-29(45)11-5-19-1-7-22(40)8-2-19/h1-12,15-16,27-28,31-44,47-50H,13-14,17-18H2/b11-5+,12-6+/t27-,28-,31-,32+,33-,34-,35-,36-,37-,38+/m1/s1 |
InChI Key | GKIBFAJWPMKFPD-QKRVJUIFSA-N |
Popularity | 0 references in papers |
Molecular Formula | C38H42O18 |
Molecular Weight | 786.70 g/mol |
Exact Mass | 786.23711449 g/mol |
Topological Polar Surface Area (TPSA) | 292.00 Ų |
XlogP | 0.70 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.61% | 91.11% |
CHEMBL3194 | P02766 | Transthyretin | 96.89% | 90.71% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 96.00% | 86.33% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 94.82% | 99.17% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 92.69% | 96.09% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.63% | 89.00% |
CHEMBL4016 | P42262 | Glutamate receptor ionotropic, AMPA 2 | 92.12% | 86.92% |
CHEMBL2035 | P08912 | Muscarinic acetylcholine receptor M5 | 90.91% | 94.62% |
CHEMBL1075094 | Q16236 | Nuclear factor erythroid 2-related factor 2 | 90.12% | 96.00% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 90.02% | 94.45% |
CHEMBL3401 | O75469 | Pregnane X receptor | 89.76% | 94.73% |
CHEMBL1951 | P21397 | Monoamine oxidase A | 89.62% | 91.49% |
CHEMBL226 | P30542 | Adenosine A1 receptor | 88.93% | 95.93% |
CHEMBL2563 | Q9UQL6 | Histone deacetylase 5 | 88.13% | 89.67% |
CHEMBL3004 | P33527 | Multidrug resistance-associated protein 1 | 86.29% | 96.37% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 85.09% | 97.09% |
CHEMBL2085 | P14174 | Macrophage migration inhibitory factor | 84.55% | 80.78% |
CHEMBL2288 | Q13526 | Peptidyl-prolyl cis-trans isomerase NIMA-interacting 1 | 83.76% | 91.71% |
CHEMBL2581 | P07339 | Cathepsin D | 83.75% | 98.95% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 83.28% | 95.89% |
CHEMBL3091268 | Q92753 | Nuclear receptor ROR-beta | 82.50% | 95.50% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 82.50% | 85.00% |
CHEMBL5255 | O00206 | Toll-like receptor 4 | 81.93% | 92.50% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 81.88% | 96.95% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Digitalis lanata |
PubChem | 102482897 |
LOTUS | LTS0210940 |
wikiData | Q105010020 |