(2R,8R)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-8-(4-methylpent-3-enyl)-2,3-dihydropyrano[2,3-h]chromen-4-one
Internal ID | e72c6b34-bc7a-4a6a-a0c9-7ffeed10b220 |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (2R,8R)-5-hydroxy-2-(4-hydroxyphenyl)-8-methyl-8-(4-methylpent-3-enyl)-2,3-dihydropyrano[2,3-h]chromen-4-one |
SMILES (Canonical) | CC(=CCCC1(C=CC2=C(O1)C=C(C3=C2OC(CC3=O)C4=CC=C(C=C4)O)O)C)C |
SMILES (Isomeric) | CC(=CCC[C@@]1(C=CC2=C(O1)C=C(C3=C2O[C@H](CC3=O)C4=CC=C(C=C4)O)O)C)C |
InChI | InChI=1S/C25H26O5/c1-15(2)5-4-11-25(3)12-10-18-22(30-25)14-20(28)23-19(27)13-21(29-24(18)23)16-6-8-17(26)9-7-16/h5-10,12,14,21,26,28H,4,11,13H2,1-3H3/t21-,25-/m1/s1 |
InChI Key | VSBUTPUUSVOZDI-PXDATVDWSA-N |
Popularity | 0 references in papers |
Molecular Formula | C25H26O5 |
Molecular Weight | 406.50 g/mol |
Exact Mass | 406.17802393 g/mol |
Topological Polar Surface Area (TPSA) | 76.00 Ų |
XlogP | 5.60 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.66% | 91.11% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 98.72% | 94.45% |
CHEMBL2581 | P07339 | Cathepsin D | 96.60% | 98.95% |
CHEMBL4261 | Q16665 | Hypoxia-inducible factor 1 alpha | 96.06% | 85.14% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 93.62% | 89.00% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 93.42% | 96.09% |
CHEMBL3137262 | O60341 | LSD1/CoREST complex | 92.94% | 97.09% |
CHEMBL3401 | O75469 | Pregnane X receptor | 91.31% | 94.73% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 90.79% | 95.56% |
CHEMBL4208 | P20618 | Proteasome component C5 | 87.30% | 90.00% |
CHEMBL5845 | P23415 | Glycine receptor subunit alpha-1 | 86.68% | 90.71% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 85.73% | 99.17% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 85.41% | 95.89% |
CHEMBL1994 | P08235 | Mineralocorticoid receptor | 84.81% | 100.00% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 84.74% | 86.33% |
CHEMBL2553 | Q15418 | Ribosomal protein S6 kinase alpha 1 | 83.72% | 85.11% |
CHEMBL4481 | P35228 | Nitric oxide synthase, inducible | 81.96% | 94.80% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 81.60% | 99.23% |
CHEMBL5697 | Q9GZT9 | Egl nine homolog 1 | 81.04% | 93.40% |
CHEMBL5852 | Q96P65 | Pyroglutamylated RFamide peptide receptor | 80.73% | 85.00% |
CHEMBL1907603 | Q05586 | Glutamate NMDA receptor; GRIN1/GRIN2B | 80.36% | 95.89% |
CHEMBL2964 | P36507 | Dual specificity mitogen-activated protein kinase kinase 2 | 80.34% | 80.00% |
CHEMBL1914 | P06276 | Butyrylcholinesterase | 80.06% | 95.00% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 154496414 |
LOTUS | LTS0207145 |
wikiData | Q105292120 |