(6R)-2,3,8-trihydroxy-10-methoxy-11-(3-methylbut-2-enyl)-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one
Internal ID | 43db35fb-6607-4e99-819a-e9892d56383a |
Taxonomy | Phenylpropanoids and polyketides > Flavonoids > Pyranoflavonoids |
IUPAC Name | (6R)-2,3,8-trihydroxy-10-methoxy-11-(3-methylbut-2-enyl)-6-(2-methylprop-1-enyl)-6H-chromeno[4,3-b]chromen-7-one |
SMILES (Canonical) | CC(=CCC1=C(C=C(C2=C1OC3=C(C2=O)C(OC4=CC(=C(C=C43)O)O)C=C(C)C)O)OC)C |
SMILES (Isomeric) | CC(=CCC1=C(C=C(C2=C1OC3=C(C2=O)[C@H](OC4=CC(=C(C=C43)O)O)C=C(C)C)O)OC)C |
InChI | InChI=1S/C26H26O7/c1-12(2)6-7-14-19(31-5)11-18(29)22-24(30)23-21(8-13(3)4)32-20-10-17(28)16(27)9-15(20)26(23)33-25(14)22/h6,8-11,21,27-29H,7H2,1-5H3/t21-/m1/s1 |
InChI Key | FIYIGIGIGDUJQB-OAQYLSRUSA-N |
Popularity | 0 references in papers |
Molecular Formula | C26H26O7 |
Molecular Weight | 450.50 g/mol |
Exact Mass | 450.16785316 g/mol |
Topological Polar Surface Area (TPSA) | 105.00 Ų |
XlogP | 5.80 |
There are no found synonyms. |
Target | Value | Probability (raw) | Probability (%) |
---|---|---|---|
No predicted properties yet! |
Proven Targets:
CHEMBL ID | UniProt ID | Name | Min activity | Assay type | Source |
---|---|---|---|---|---|
No proven targets yet! |
Predicted Targets (via Super-PRED):
CHEMBL ID | UniProt ID | Name | Probability | Model accuracy |
---|---|---|---|---|
CHEMBL5619 | P27695 | DNA-(apurinic or apyrimidinic site) lyase | 99.12% | 91.11% |
CHEMBL4793 | Q86TI2 | Dipeptidyl peptidase IX | 92.89% | 96.95% |
CHEMBL1806 | P11388 | DNA topoisomerase II alpha | 92.20% | 89.00% |
CHEMBL3108638 | O15164 | Transcription intermediary factor 1-alpha | 91.21% | 95.56% |
CHEMBL2581 | P07339 | Cathepsin D | 90.79% | 98.95% |
CHEMBL4203 | Q9HAZ1 | Dual specificity protein kinase CLK4 | 89.67% | 94.45% |
CHEMBL3060 | Q9Y345 | Glycine transporter 2 | 89.34% | 99.17% |
CHEMBL1293249 | Q13887 | Kruppel-like factor 5 | 89.25% | 86.33% |
CHEMBL2635 | P51452 | Dual specificity protein phosphatase 3 | 89.23% | 94.00% |
CHEMBL3194 | P02766 | Transthyretin | 87.92% | 90.71% |
CHEMBL241 | Q14432 | Phosphodiesterase 3A | 87.54% | 92.94% |
CHEMBL3401 | O75469 | Pregnane X receptor | 86.31% | 94.73% |
CHEMBL1163101 | O75460 | Serine/threonine-protein kinase/endoribonuclease IRE1 | 85.59% | 98.11% |
CHEMBL3038477 | P67870 | Casein kinase II alpha/beta | 83.73% | 99.23% |
CHEMBL3251 | P19838 | Nuclear factor NF-kappa-B p105 subunit | 83.43% | 96.09% |
CHEMBL2373 | P21730 | C5a anaphylatoxin chemotactic receptor | 82.72% | 92.62% |
CHEMBL5608 | Q16288 | NT-3 growth factor receptor | 81.93% | 95.89% |
CHEMBL2413 | P32246 | C-C chemokine receptor type 1 | 80.98% | 89.50% |
Below are displayed all the plants proven (via scientific papers) to contain this
compound!
To see more specific details click the taxa you are interested in.
To see more specific details click the taxa you are interested in.
Artocarpus altilis |
PubChem | 154496483 |
LOTUS | LTS0197969 |
wikiData | Q104995931 |